1-[(3S,8R,9S,10R,13S,14S,17S)-14,17-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methoxyethanone
Internal ID | 808bdb1a-4b34-495b-95a6-4c33066db242 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 1-[(3S,8R,9S,10R,13S,14S,17S)-14,17-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methoxyethanone |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4CCC5(C6CCC7(C(C6CC=C5C4)(CCC7(C(=O)COC)O)O)C)C)C)C)OC)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H](C[C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@@H]3OC)O[C@H]4CC[C@@]5([C@H]6CC[C@]7([C@@]([C@@H]6CC=C5C4)(CC[C@]7(C(=O)COC)O)O)C)C)C)C)OC)O |
InChI | InChI=1S/C43H70O14/c1-23-37(45)30(49-7)19-35(52-23)56-39-25(3)54-36(21-32(39)51-9)57-38-24(2)53-34(20-31(38)50-8)55-27-12-14-40(4)26(18-27)10-11-29-28(40)13-15-41(5)42(29,46)16-17-43(41,47)33(44)22-48-6/h10,23-25,27-32,34-39,45-47H,11-22H2,1-9H3/t23-,24-,25-,27+,28+,29-,30-,31+,32+,34+,35+,36+,37-,38-,39-,40+,41+,42+,43-/m1/s1 |
InChI Key | GNPLZKHJKZIYLO-LLXWGFFOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H70O14 |
Molecular Weight | 811.00 g/mol |
Exact Mass | 810.47655690 g/mol |
Topological Polar Surface Area (TPSA) | 170.00 Ų |
XlogP | 3.00 |
There are no found synonyms. |
![2D Structure of 1-[(3S,8R,9S,10R,13S,14S,17S)-14,17-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methoxyethanone 2D Structure of 1-[(3S,8R,9S,10R,13S,14S,17S)-14,17-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methoxyethanone](https://plantaedb.com/storage/docs/compounds/2023/11/2e584550-8587-11ee-9f80-e52f34e020d9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.27% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.45% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.30% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.81% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.53% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.37% | 95.93% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 89.94% | 87.16% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.06% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.03% | 94.45% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.86% | 96.38% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.77% | 95.89% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.30% | 95.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.10% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.01% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.16% | 91.07% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.18% | 94.33% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.61% | 98.59% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.55% | 85.14% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 83.80% | 94.50% |
CHEMBL5028 | O14672 | ADAM10 | 81.17% | 97.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.78% | 95.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.70% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 80.48% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 102041441 |
LOTUS | LTS0022056 |
wikiData | Q105013047 |