(2E,4E,8Z,11Z)-N-[(2S)-butan-2-yl]tetradeca-2,4,8,11-tetraenamide
| Internal ID | 4ad26da6-551b-458a-943a-5c914899b3dc |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (2E,4E,8Z,11Z)-N-[(2S)-butan-2-yl]tetradeca-2,4,8,11-tetraenamide |
| SMILES (Canonical) | CCC=CCC=CCCC=CC=CC(=O)NC(C)CC |
| SMILES (Isomeric) | CC/C=C\C/C=C\CC/C=C/C=C/C(=O)N[C@@H](C)CC |
| InChI | InChI=1S/C18H29NO/c1-4-6-7-8-9-10-11-12-13-14-15-16-18(20)19-17(3)5-2/h6-7,9-10,13-17H,4-5,8,11-12H2,1-3H3,(H,19,20)/b7-6-,10-9-,14-13+,16-15+/t17-/m0/s1 |
| InChI Key | ASRZUUIQEMYXLQ-BWNQCOBISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.224914549 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
![2D Structure of (2E,4E,8Z,11Z)-N-[(2S)-butan-2-yl]tetradeca-2,4,8,11-tetraenamide](https://plantaedb.com/storage/docs/compounds/2023/11/2e4e8z11z-n-2s-butan-2-yltetradeca-24811-tetraenamide.jpg "2D Structure of (2E,4E,8Z,11Z)-N-[(2S)-butan-2-yl]tetradeca-2,4,8,11-tetraenamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.46% | 89.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.62% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.52% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.32% | 99.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.28% | 100.00% |
| CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha | 87.39% | 90.75% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.16% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.79% | 96.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.55% | 96.47% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.74% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.67% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum integrifoliolum |
| PubChem | 163042941 |
| LOTUS | LTS0149771 |
| wikiData | Q104918028 |