(2E,4E,8Z,10E)-12-hydroxy-N-(2-methylpropyl)tetradeca-2,4,8,10-tetraenamide
| Internal ID | 18ac6d6f-4d7f-40de-b26b-e49849a6b605 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (2E,4E,8Z,10E)-12-hydroxy-N-(2-methylpropyl)tetradeca-2,4,8,10-tetraenamide |
| SMILES (Canonical) | CCC(C=CC=CCCC=CC=CC(=O)NCC(C)C)O |
| SMILES (Isomeric) | CCC(/C=C/C=C\CC/C=C/C=C/C(=O)NCC(C)C)O |
| InChI | InChI=1S/C18H29NO2/c1-4-17(20)13-11-9-7-5-6-8-10-12-14-18(21)19-15-16(2)3/h7-14,16-17,20H,4-6,15H2,1-3H3,(H,19,21)/b9-7-,10-8+,13-11+,14-12+ |
| InChI Key | GXRQZKLWHNBLTO-FEECMKHQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.219829168 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.79% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.89% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.47% | 89.34% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.37% | 97.29% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.89% | 100.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.73% | 95.71% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.97% | 96.38% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.25% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.30% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.96% | 96.47% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.77% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.22% | 96.00% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 81.73% | 80.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.54% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.34% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.30% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.30% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.65% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum integrifoliolum |
| PubChem | 101153416 |
| LOTUS | LTS0196294 |
| wikiData | Q104667080 |