(2E,4E,6Z,12Z)-N-(3-methylbutyl)tetradeca-2,4,6,12-tetraen-8,10-diynamide
| Internal ID | e8bac13d-1cda-477a-86d0-79bcdfc94cbf |
| Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
| IUPAC Name | (2E,4E,6Z,12Z)-N-(3-methylbutyl)tetradeca-2,4,6,12-tetraen-8,10-diynamide |
| SMILES (Canonical) | CC=CC#CC#CC=CC=CC=CC(=O)NCCC(C)C |
| SMILES (Isomeric) | C/C=C\C#CC#C/C=C\C=C\C=C\C(=O)NCCC(C)C |
| InChI | InChI=1S/C19H23NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-19(21)20-17-16-18(2)3/h4-5,10-15,18H,16-17H2,1-3H3,(H,20,21)/b5-4-,11-10-,13-12+,15-14+ |
| InChI Key | MUWVVXZTDXINSN-UEHDFXONSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.177964357 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.06% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.68% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.59% | 89.34% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.19% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.90% | 90.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.83% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.08% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.79% | 94.73% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.01% | 97.29% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.52% | 94.45% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.58% | 89.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.55% | 90.71% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.02% | 96.47% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.23% | 98.75% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.48% | 93.56% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.47% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achillea santolinoides subsp. wilhelmsii |
| PubChem | 14015856 |
| LOTUS | LTS0080568 |
| wikiData | Q105172791 |