(2E,4E)-N-[(2S)-butan-2-yl]-8-oxotetradeca-2,4-dienamide
| Internal ID | d29e6716-402a-42f7-82b7-756e5d43f0e7 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (2E,4E)-N-[(2S)-butan-2-yl]-8-oxotetradeca-2,4-dienamide |
| SMILES (Canonical) | CCCCCCC(=O)CCC=CC=CC(=O)NC(C)CC |
| SMILES (Isomeric) | CCCCCCC(=O)CC/C=C/C=C/C(=O)N[C@@H](C)CC |
| InChI | InChI=1S/C18H31NO2/c1-4-6-7-10-13-17(20)14-11-8-9-12-15-18(21)19-16(3)5-2/h8-9,12,15-16H,4-7,10-11,13-14H2,1-3H3,(H,19,21)/b9-8+,15-12+/t16-/m0/s1 |
| InChI Key | MBUPMCAGGCGJDW-XQUXRVDVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.235479232 g/mol |
| Topological Polar Surface Area (TPSA) | 46.20 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
![2D Structure of (2E,4E)-N-[(2S)-butan-2-yl]-8-oxotetradeca-2,4-dienamide](https://plantaedb.com/storage/docs/compounds/2023/11/2e4e-n-2s-butan-2-yl-8-oxotetradeca-24-dienamide.jpg "2D Structure of (2E,4E)-N-[(2S)-butan-2-yl]-8-oxotetradeca-2,4-dienamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.02% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.53% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.16% | 89.34% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 93.19% | 98.03% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.13% | 92.86% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.98% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.97% | 97.29% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 91.28% | 85.94% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 90.20% | 95.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.17% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.20% | 93.56% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 89.20% | 92.08% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.88% | 96.47% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.84% | 89.63% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.16% | 94.33% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.77% | 95.71% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.57% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.13% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.67% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.98% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum integrifoliolum |
| PubChem | 163105005 |
| LOTUS | LTS0234561 |
| wikiData | Q105160968 |