(2E,4E)-N-[2-(4-methoxyphenyl)ethyl]deca-2,4-dienamide
| Internal ID | 89672305-9451-412f-81f8-affcd9f8380e |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | (2E,4E)-N-[2-(4-methoxyphenyl)ethyl]deca-2,4-dienamide |
| SMILES (Canonical) | CCCCCC=CC=CC(=O)NCCC1=CC=C(C=C1)OC |
| SMILES (Isomeric) | CCCCC/C=C/C=C/C(=O)NCCC1=CC=C(C=C1)OC |
| InChI | InChI=1S/C19H27NO2/c1-3-4-5-6-7-8-9-10-19(21)20-16-15-17-11-13-18(22-2)14-12-17/h7-14H,3-6,15-16H2,1-2H3,(H,20,21)/b8-7+,10-9+ |
| InChI Key | WOVBLOXQMWZOCT-XBLVEGMJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.204179104 g/mol |
| Topological Polar Surface Area (TPSA) | 38.30 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
![2D Structure of (2E,4E)-N-[2-(4-methoxyphenyl)ethyl]deca-2,4-dienamide](https://plantaedb.com/storage/docs/compounds/2023/11/2e4e-n-2-4-methoxyphenylethyldeca-24-dienamide.jpg "2D Structure of (2E,4E)-N-[2-(4-methoxyphenyl)ethyl]deca-2,4-dienamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.16% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.99% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.02% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.88% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.42% | 90.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.67% | 92.08% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.99% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.60% | 94.45% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 89.50% | 89.33% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 89.45% | 96.67% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.13% | 96.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.44% | 97.29% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.35% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.05% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.37% | 86.33% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.27% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.93% | 95.56% |
| CHEMBL240 | Q12809 | HERG | 84.12% | 89.76% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.84% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.83% | 94.73% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.47% | 94.33% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 80.37% | 86.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achillea millefolium |
| PubChem | 14427405 |
| LOTUS | LTS0178822 |
| wikiData | Q105309703 |