(2E,4E)-4,6,8-trimethyldeca-2,4-dienoic acid
| Internal ID | 4fd19a7b-9b20-4340-8157-68ebe96f5a9f |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Acyclic monoterpenoids |
| IUPAC Name | (2E,4E)-4,6,8-trimethyldeca-2,4-dienoic acid |
| SMILES (Canonical) | CCC(C)CC(C)C=C(C)C=CC(=O)O |
| SMILES (Isomeric) | CCC(C)CC(C)/C=C(\C)/C=C/C(=O)O |
| InChI | InChI=1S/C13H22O2/c1-5-10(2)8-12(4)9-11(3)6-7-13(14)15/h6-7,9-10,12H,5,8H2,1-4H3,(H,14,15)/b7-6+,11-9+ |
| InChI Key | OILLDIIQDQVGSY-RXUIJTJXSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.161979940 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 4.50 |
| (2E,4E)-4,6,8-trimethyldeca-2,4-dienoic acid |
| CHEBI:189150 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.03% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.43% | 98.95% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 88.63% | 97.64% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.90% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.84% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.80% | 96.95% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.69% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.11% | 93.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.33% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 24740398 |
| LOTUS | LTS0163106 |
| wikiData | Q77374969 |