(2E,4E)-1-(Pyrrolidin-1-yl)dodeca-2,4-dien-1-one
| Internal ID | 819ec9ca-3f27-4d05-b7d5-e61b8f9d9815 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolidines > N-acylpyrrolidines |
| IUPAC Name | (2E,4E)-1-pyrrolidin-1-yldodeca-2,4-dien-1-one |
| SMILES (Canonical) | CCCCCCCC=CC=CC(=O)N1CCCC1 |
| SMILES (Isomeric) | CCCCCCC/C=C/C=C/C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H27NO/c1-2-3-4-5-6-7-8-9-10-13-16(18)17-14-11-12-15-17/h8-10,13H,2-7,11-12,14-15H2,1H3/b9-8+,13-10+ |
| InChI Key | UAIYHWLHQSKQLW-PEGOPYGQSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.209264485 g/mol |
| Topological Polar Surface Area (TPSA) | 20.30 Ų |
| XlogP | 4.80 |
| CHEBI:70093 |
| 2,4-Dodecadienoic acid pyrrolidide |
| (2E,4E)-1-pyrrolidin-1-yldodeca-2,4-dien-1-one |
| (2E,4E)-1-(Pyrrolidin-1-yl)dodeca-2,4-dien-1-one |
| 117137-69-6 |
| CHEMBL3338739 |
| SCHEMBL17091584 |
| SCHEMBL17091586 |
| UAIYHWLHQSKQLW-PEGOPYGQSA-N |
| 1-(2,4-Dodecadienoyl)pyrrolidine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.26% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.14% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.49% | 98.95% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.83% | 92.86% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 93.10% | 91.81% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.31% | 99.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 88.04% | 92.08% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.97% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.29% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.70% | 94.33% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.62% | 97.00% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 82.31% | 93.90% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 81.36% | 95.27% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.01% | 90.24% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.60% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper nigrum |
| PubChem | 10999431 |
| LOTUS | LTS0091682 |
| wikiData | Q27138431 |