(3S,7S,8S,9R,10R,13R,14S,17R)-3-hydroxy-7-methoxy-4,4,13,14-tetramethyl-17-[(2R,4E)-6-methylhepta-4,6-dien-2-yl]-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-9-carbaldehyde
| Internal ID | 226bfec5-82e1-4d71-96e4-d36c0e32761f |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
| IUPAC Name | (3S,7S,8S,9R,10R,13R,14S,17R)-3-hydroxy-7-methoxy-4,4,13,14-tetramethyl-17-[(2R,4E)-6-methylhepta-4,6-dien-2-yl]-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-9-carbaldehyde |
| SMILES (Canonical) | CC(CC=CC(=C)C)C1CCC2(C1(CCC3(C2C(C=C4C3CCC(C4(C)C)O)OC)C=O)C)C |
| SMILES (Isomeric) | C[C@H](C/C=C/C(=C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2[C@H](C=C4[C@H]3CC[C@@H](C4(C)C)O)OC)C=O)C)C |
| InChI | InChI=1S/C31H48O3/c1-20(2)10-9-11-21(3)22-14-15-30(7)27-25(34-8)18-24-23(12-13-26(33)28(24,4)5)31(27,19-32)17-16-29(22,30)6/h9-10,18-19,21-23,25-27,33H,1,11-17H2,2-8H3/b10-9+/t21-,22-,23-,25+,26+,27+,29-,30+,31-/m1/s1 |
| InChI Key | WZZAXQGYJDXEDP-UJBPRPQUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.36034539 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 7.00 |
| There are no found synonyms. |
![2D Structure of (3S,7S,8S,9R,10R,13R,14S,17R)-3-hydroxy-7-methoxy-4,4,13,14-tetramethyl-17-[(2R,4E)-6-methylhepta-4,6-dien-2-yl]-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-9-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/2e0c4930-85ee-11ee-beed-a742e91c620a.jpg "2D Structure of (3S,7S,8S,9R,10R,13R,14S,17R)-3-hydroxy-7-methoxy-4,4,13,14-tetramethyl-17-[(2R,4E)-6-methylhepta-4,6-dien-2-yl]-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-9-carbaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.14% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.78% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.86% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.79% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.51% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.17% | 94.45% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.39% | 91.07% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.83% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.09% | 86.33% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.57% | 93.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.44% | 100.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.12% | 100.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.88% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.20% | 98.95% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.18% | 97.28% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.12% | 82.69% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.95% | 95.89% |
| CHEMBL5028 | O14672 | ADAM10 | 80.75% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Momordica charantia |
| PubChem | 11167279 |
| LOTUS | LTS0263536 |
| wikiData | Q105323700 |