(2E)-N-Methyl-3-phenyl-N-(2-phenylethyl)-2-propenamide
Internal ID | c97e6910-d910-4643-9a35-185b18bd7747 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives |
IUPAC Name | (E)-N-methyl-3-phenyl-N-(2-phenylethyl)prop-2-enamide |
SMILES (Canonical) | CN(CCC1=CC=CC=C1)C(=O)C=CC2=CC=CC=C2 |
SMILES (Isomeric) | CN(CCC1=CC=CC=C1)C(=O)/C=C/C2=CC=CC=C2 |
InChI | InChI=1S/C18H19NO/c1-19(15-14-17-10-6-3-7-11-17)18(20)13-12-16-8-4-2-5-9-16/h2-13H,14-15H2,1H3/b13-12+ |
InChI Key | FXOMVQIRHBIDBI-OUKQBFOZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H19NO |
Molecular Weight | 265.30 g/mol |
Exact Mass | 265.146664230 g/mol |
Topological Polar Surface Area (TPSA) | 20.30 Ų |
XlogP | 3.80 |
DTXSID801208639 |
121817-38-7 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.04% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.35% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.39% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.01% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.35% | 90.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.87% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.31% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.51% | 99.17% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.29% | 93.99% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.72% | 95.50% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 81.32% | 96.25% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.42% | 91.71% |
CHEMBL5028 | O14672 | ADAM10 | 80.16% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clausena lansium |
PubChem | 11184674 |
LOTUS | LTS0189232 |
wikiData | Q105004135 |