(2E)-3-(3-bromo-4-methoxyphenyl)-N-[2-(3-bromo-4-methoxyphenyl)ethyl]-2-methoxyiminopropanamide
| Internal ID | 60bae5ea-c13b-4899-9a5a-f7b329686954 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | (2E)-3-(3-bromo-4-methoxyphenyl)-N-[2-(3-bromo-4-methoxyphenyl)ethyl]-2-methoxyiminopropanamide |
| SMILES (Canonical) | COC1=C(C=C(C=C1)CCNC(=O)C(=NOC)CC2=CC(=C(C=C2)OC)Br)Br |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)CCNC(=O)/C(=N/OC)/CC2=CC(=C(C=C2)OC)Br)Br |
| InChI | InChI=1S/C20H22Br2N2O4/c1-26-18-6-4-13(10-15(18)21)8-9-23-20(25)17(24-28-3)12-14-5-7-19(27-2)16(22)11-14/h4-7,10-11H,8-9,12H2,1-3H3,(H,23,25)/b24-17+ |
| InChI Key | DHKCNFLKLGTGQS-JJIBRWJFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22Br2N2O4 |
| Molecular Weight | 514.20 g/mol |
| Exact Mass | 513.99258 g/mol |
| Topological Polar Surface Area (TPSA) | 69.20 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.35% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.76% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.71% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.05% | 98.75% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.90% | 90.20% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.67% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.47% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.36% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.82% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.08% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.54% | 95.50% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 83.30% | 94.01% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.67% | 91.11% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.05% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 23426998 |
| LOTUS | LTS0121741 |
| wikiData | Q104980277 |