N-[4-amino-1-[[1-[[4-amino-1-oxo-1-[[6,9,18-tris(2-aminoethyl)-12-ethyl-3-(1-hydroxyethyl)-15-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]-6-methyloctanamide
| Internal ID | 5ad2b5e3-518a-4339-8261-c9a97f3f4e41 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | N-[4-amino-1-[[1-[[4-amino-1-oxo-1-[[6,9,18-tris(2-aminoethyl)-12-ethyl-3-(1-hydroxyethyl)-15-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]-6-methyloctanamide |
| SMILES (Canonical) | CCC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCCC(C(=O)NC(C(=O)NC(C(=O)N1)CC(C)C)CCN)NC(=O)C(CCN)NC(=O)C(C(C)O)NC(=O)C(CCN)NC(=O)CCCCC(C)CC)C(C)O)CCN)CCN |
| SMILES (Isomeric) | CCC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCCC(C(=O)NC(C(=O)NC(C(=O)N1)CC(C)C)CCN)NC(=O)C(CCN)NC(=O)C(C(C)O)NC(=O)C(CCN)NC(=O)CCCCC(C)CC)C(C)O)CCN)CCN |
| InChI | InChI=1S/C51H96N16O13/c1-8-28(5)12-10-11-13-39(70)58-32(14-20-52)47(76)67-41(30(7)69)51(80)64-35(17-23-55)44(73)63-37-19-25-57-50(79)40(29(6)68)66-48(77)36(18-24-56)62-43(72)33(15-21-53)60-42(71)31(9-2)59-49(78)38(26-27(3)4)65-45(74)34(16-22-54)61-46(37)75/h27-38,40-41,68-69H,8-26,52-56H2,1-7H3,(H,57,79)(H,58,70)(H,59,78)(H,60,71)(H,61,75)(H,62,72)(H,63,73)(H,64,80)(H,65,74)(H,66,77)(H,67,76) |
| InChI Key | OVODYYFQBMUPHB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C51H96N16O13 |
| Molecular Weight | 1141.40 g/mol |
| Exact Mass | 1140.73427718 g/mol |
| Topological Polar Surface Area (TPSA) | 491.00 Ų |
| XlogP | -3.60 |
| Atomic LogP (AlogP) | -6.08 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 18 |
| Rotatable Bonds | 28 |
| There are no found synonyms. |
![2D Structure of N-[4-amino-1-[[1-[[4-amino-1-oxo-1-[[6,9,18-tris(2-aminoethyl)-12-ethyl-3-(1-hydroxyethyl)-15-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]-6-methyloctanamide](https://plantaedb.com/storage/docs/compounds/2023/11/2dcdc4f0-85f1-11ee-a0ad-f9dbe3ac4cf2.jpg "2D Structure of N-[4-amino-1-[[1-[[4-amino-1-oxo-1-[[6,9,18-tris(2-aminoethyl)-12-ethyl-3-(1-hydroxyethyl)-15-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]-6-methyloctanamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6644 | 66.44% |
| Caco-2 | - | 0.8596 | 85.96% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | - | 0.6857 | 68.57% |
| Subcellular localzation | Mitochondria | 0.5232 | 52.32% |
| OATP2B1 inhibitior | - | 0.8608 | 86.08% |
| OATP1B1 inhibitior | + | 0.9126 | 91.26% |
| OATP1B3 inhibitior | + | 0.9041 | 90.41% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 1.0000 | 100.00% |
| BSEP inhibitior | + | 0.8506 | 85.06% |
| P-glycoprotein inhibitior | + | 0.7400 | 74.00% |
| P-glycoprotein substrate | + | 0.8728 | 87.28% |
| CYP3A4 substrate | + | 0.6854 | 68.54% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7691 | 76.91% |
| CYP3A4 inhibition | - | 0.8879 | 88.79% |
| CYP2C9 inhibition | - | 0.9387 | 93.87% |
| CYP2C19 inhibition | - | 0.9139 | 91.39% |
| CYP2D6 inhibition | - | 0.9290 | 92.90% |
| CYP1A2 inhibition | - | 0.9372 | 93.72% |
| CYP2C8 inhibition | + | 0.5798 | 57.98% |
| CYP inhibitory promiscuity | - | 0.9937 | 99.37% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8200 | 82.00% |
| Carcinogenicity (trinary) | Non-required | 0.6317 | 63.17% |
| Eye corrosion | - | 0.9824 | 98.24% |
| Eye irritation | - | 0.8962 | 89.62% |
| Skin irritation | - | 0.7712 | 77.12% |
| Skin corrosion | - | 0.9189 | 91.89% |
| Ames mutagenesis | - | 0.7400 | 74.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3920 | 39.20% |
| Micronuclear | + | 0.7400 | 74.00% |
| Hepatotoxicity | - | 0.7325 | 73.25% |
| skin sensitisation | - | 0.8776 | 87.76% |
| Respiratory toxicity | + | 0.7111 | 71.11% |
| Reproductive toxicity | + | 0.8111 | 81.11% |
| Mitochondrial toxicity | + | 0.6875 | 68.75% |
| Nephrotoxicity | + | 0.8353 | 83.53% |
| Acute Oral Toxicity (c) | III | 0.7748 | 77.48% |
| Estrogen receptor binding | + | 0.7618 | 76.18% |
| Androgen receptor binding | + | 0.5870 | 58.70% |
| Thyroid receptor binding | - | 0.6671 | 66.71% |
| Glucocorticoid receptor binding | + | 0.5869 | 58.69% |
| Aromatase binding | + | 0.7075 | 70.75% |
| PPAR gamma | + | 0.7341 | 73.41% |
| Honey bee toxicity | - | 0.8050 | 80.50% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.6200 | 62.00% |
| Fish aquatic toxicity | - | 0.6353 | 63.53% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.36% | 98.95% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 98.77% | 98.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.52% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.11% | 97.09% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.10% | 96.61% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 97.49% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.06% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.45% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.44% | 94.45% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 96.29% | 97.23% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 95.26% | 88.42% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 95.12% | 98.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.43% | 90.71% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.42% | 95.93% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 94.34% | 96.11% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.85% | 96.47% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 93.32% | 94.66% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 92.72% | 95.20% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 91.74% | 94.55% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.36% | 97.25% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 91.03% | 92.88% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.76% | 95.50% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.71% | 95.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.68% | 98.59% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 90.30% | 98.94% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 89.99% | 96.06% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 89.91% | 93.18% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 89.87% | 96.33% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 89.59% | 98.24% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.45% | 96.90% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.12% | 89.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.69% | 97.14% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 87.18% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.66% | 93.03% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.19% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.09% | 100.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.83% | 90.24% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.76% | 92.50% |
| CHEMBL1801 | P00747 | Plasminogen | 84.60% | 92.44% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.26% | 95.71% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.42% | 82.38% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 83.33% | 98.03% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.25% | 92.98% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.11% | 91.03% |
| CHEMBL236 | P41143 | Delta opioid receptor | 82.98% | 99.35% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.80% | 95.38% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.60% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.16% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.95% | 90.08% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.77% | 95.58% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.35% | 93.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.27% | 97.79% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.21% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588083 |
| LOTUS | LTS0096987 |
| wikiData | Q105200892 |