2-(4-Amino-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-22-(2-amino-2-oxoethyl)-48-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-18,32,35,37-tetrahydroxy-19-[[4-methyl-2-(methylamino)pentanoyl]amino]-20,23,26,42,44-pentaoxo-7,13-dioxa-21,24,27,41,43-pentazaoctacyclo[26.14.2.23,6.214,17.18,12.129,33.010,25.034,39]pentaconta-3(50),4,6(49),8,10,12(48),14(47),15,17(46),29(45),30,32,34(39),35,37-pentadecaene-40-carboxylic acid
| Internal ID | a2ca1a08-a0b5-4f63-babd-7ed0208fb740 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-(4-amino-5-hydroxy-4,6-dimethyloxan-2-yl)oxy-22-(2-amino-2-oxoethyl)-48-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-18,32,35,37-tetrahydroxy-19-[[4-methyl-2-(methylamino)pentanoyl]amino]-20,23,26,42,44-pentaoxo-7,13-dioxa-21,24,27,41,43-pentazaoctacyclo[26.14.2.23,6.214,17.18,12.129,33.010,25.034,39]pentaconta-3(50),4,6(49),8,10,12(48),14(47),15,17(46),29(45),30,32,34(39),35,37-pentadecaene-40-carboxylic acid |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=C4C=C5C=C3OC6=CC=C(C=C6)C(C7C(=O)NC(C8=C(C(=CC(=C8)O)O)C9=C(C=CC(=C9)C(C(=O)N7)NC(=O)C5NC(=O)C(NC(=O)C(C(C1=CC=C(O4)C=C1)O)NC(=O)C(CC(C)C)NC)CC(=O)N)O)C(=O)O)OC1CC(C(C(O1)C)O)(C)N)CO)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=C4C=C5C=C3OC6=CC=C(C=C6)C(C7C(=O)NC(C8=C(C(=CC(=C8)O)O)C9=C(C=CC(=C9)C(C(=O)N7)NC(=O)C5NC(=O)C(NC(=O)C(C(C1=CC=C(O4)C=C1)O)NC(=O)C(CC(C)C)NC)CC(=O)N)O)C(=O)O)OC1CC(C(C(O1)C)O)(C)N)CO)O)O)O)O)O |
| InChI | InChI=1S/C72H87N9O28/c1-26(2)17-38(75-6)63(94)80-51-54(88)29-7-12-34(13-8-29)104-42-19-32-20-43(60(42)108-71-61(57(91)55(89)44(25-82)106-71)109-70-58(92)56(90)53(87)27(3)103-70)105-35-14-9-30(10-15-35)59(107-46-24-72(5,74)62(93)28(4)102-46)52-68(99)79-50(69(100)101)37-21-33(83)22-41(85)47(37)36-18-31(11-16-40(36)84)48(65(96)81-52)78-66(97)49(32)77-64(95)39(23-45(73)86)76-67(51)98/h7-16,18-22,26-28,38-39,44,46,48-59,61-62,70-71,75,82-85,87-93H,17,23-25,74H2,1-6H3,(H2,73,86)(H,76,98)(H,77,95)(H,78,97)(H,79,99)(H,80,94)(H,81,96)(H,100,101) |
| InChI Key | APHXQKPMYQJNNO-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C72H87N9O28 |
| Molecular Weight | 1526.50 g/mol |
| Exact Mass | 1525.56605315 g/mol |
| Topological Polar Surface Area (TPSA) | 589.00 Ų |
| XlogP | -5.00 |
| MM 49721 |
| MM-49721 |
| Vancomycin, 22-O-(3-amino-2,3,6-trideoxy-3-C-methyl-alpha-D-arabino-hexopyranosyl)-2'-O-de(3-amino-2,3,6-trideoxy-3-C-methyl-alpha-L-lyxo-hexopyranosyl)-10,19-didechloro-2'-O-(6-deoxy-alpha-D-talopyranosyl)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.91% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.62% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.36% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.24% | 97.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.20% | 91.49% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 97.63% | 96.38% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 97.40% | 96.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.77% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.57% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 95.27% | 90.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.06% | 99.35% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 94.97% | 97.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.22% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.45% | 86.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.71% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.44% | 95.56% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 91.81% | 97.53% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 91.12% | 97.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.03% | 94.45% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 90.44% | 95.83% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.99% | 99.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.98% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.45% | 91.19% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 87.33% | 92.32% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 87.15% | 91.79% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.78% | 96.47% |
| CHEMBL268 | P43235 | Cathepsin K | 86.49% | 96.85% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.16% | 100.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.06% | 89.50% |
| CHEMBL3837 | P07711 | Cathepsin L | 84.66% | 96.61% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 84.42% | 96.11% |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 84.14% | 95.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.43% | 96.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.05% | 93.10% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.24% | 95.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.85% | 100.00% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 81.78% | 92.50% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.77% | 98.05% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.57% | 85.00% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 81.38% | 80.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.56% | 90.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.38% | 100.00% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 80.33% | 92.80% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.18% | 98.75% |
| CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 80.14% | 97.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Virola surinamensis |
| PubChem | 195502 |
| LOTUS | LTS0208516 |
| wikiData | Q105195949 |