(6aR,10R,10aR)-4-hydroxy-9,9-dimethyl-6-oxo-3-propan-2-yl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-1,10-dicarbaldehyde
Internal ID | a8b5072d-d219-4b5e-8d7c-c49283a0155b |
Taxonomy | Phenylpropanoids and polyketides > 3,4-dihydrocoumarins |
IUPAC Name | (6aR,10R,10aR)-4-hydroxy-9,9-dimethyl-6-oxo-3-propan-2-yl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-1,10-dicarbaldehyde |
SMILES (Canonical) | CC(C)C1=C(C2=C(C3C(CCC(C3C=O)(C)C)C(=O)O2)C(=C1)C=O)O |
SMILES (Isomeric) | CC(C)C1=C(C2=C([C@H]3[C@@H](CCC([C@@H]3C=O)(C)C)C(=O)O2)C(=C1)C=O)O |
InChI | InChI=1S/C20H24O5/c1-10(2)13-7-11(8-21)15-16-12(19(24)25-18(15)17(13)23)5-6-20(3,4)14(16)9-22/h7-10,12,14,16,23H,5-6H2,1-4H3/t12-,14-,16+/m1/s1 |
InChI Key | HYGRYNBYOVHMAO-XPKDYRNWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O5 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 80.70 Ų |
XlogP | 3.00 |
There are no found synonyms. |
![2D Structure of (6aR,10R,10aR)-4-hydroxy-9,9-dimethyl-6-oxo-3-propan-2-yl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-1,10-dicarbaldehyde 2D Structure of (6aR,10R,10aR)-4-hydroxy-9,9-dimethyl-6-oxo-3-propan-2-yl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-1,10-dicarbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/2d301250-8625-11ee-a9da-55bf7c15cb40.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.31% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.34% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.69% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.41% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 91.50% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.73% | 89.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.50% | 83.82% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.36% | 93.40% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.23% | 96.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.70% | 93.04% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 88.83% | 95.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.46% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.63% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.05% | 97.09% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.84% | 98.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.96% | 99.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.93% | 99.15% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.13% | 97.25% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.01% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rosmarinus officinalis |
PubChem | 162963774 |
LOTUS | LTS0106237 |
wikiData | Q105035309 |