[(3S,4S,5R,6S)-4,5-diacetyloxy-6-[[(3S,6R,8S,11R,12S,15S,16R,19S,21R)-19-acetyloxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-enyl]oxy]oxan-3-yl] (E)-3-(4-acetyloxyphenyl)prop-2-enoate
| Internal ID | 228753aa-9823-4eda-94a8-735cee8abec4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[[(3S,6R,8S,11R,12S,15S,16R,19S,21R)-19-acetyloxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-enyl]oxy]oxan-3-yl] (E)-3-(4-acetyloxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC(=O)OC1CCC2(C3CCC4C(CCC5C4(CCC(C5(C)C)OC6C(C(C(CO6)OC(=O)C=CC7=CC=C(C=C7)OC(=O)C)OC(=O)C)OC(=O)C)C)(CC3=CCC2C1(C)C)C)C |
| SMILES (Isomeric) | CC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@H]4[C@@](CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)OC(=O)/C=C/C7=CC=C(C=C7)OC(=O)C)OC(=O)C)OC(=O)C)C)(CC3=CC[C@H]2C1(C)C)C)C |
| InChI | InChI=1S/C52H72O12/c1-30(53)59-36-16-12-34(13-17-36)14-21-44(57)63-38-29-58-47(46(62-33(4)56)45(38)61-32(3)55)64-43-24-27-52(11)40(49(43,7)8)22-25-50(9)28-35-15-19-39-48(5,6)42(60-31(2)54)23-26-51(39,10)37(35)18-20-41(50)52/h12-17,21,37-43,45-47H,18-20,22-29H2,1-11H3/b21-14+/t37-,38-,39-,40-,41-,42-,43-,45-,46+,47-,50-,51+,52-/m0/s1 |
| InChI Key | YDQIPILJJKOWCG-XZUFBIRPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C52H72O12 |
| Molecular Weight | 889.10 g/mol |
| Exact Mass | 888.50237773 g/mol |
| Topological Polar Surface Area (TPSA) | 150.00 Ų |
| XlogP | 10.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.67% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.29% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.66% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.54% | 90.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.77% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.39% | 95.56% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 91.73% | 83.57% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.27% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.18% | 94.45% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 90.10% | 85.30% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.27% | 89.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.30% | 97.28% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.81% | 92.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.42% | 90.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.40% | 91.07% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.21% | 93.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.10% | 94.75% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.61% | 95.71% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.92% | 89.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.76% | 99.17% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.47% | 85.31% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.44% | 85.49% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 80.27% | 95.92% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.06% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lycopodiella inundata |
| PubChem | 163186103 |
| LOTUS | LTS0078624 |
| wikiData | Q105346904 |