2-[2-[1-(3-Hydroxy-2,4-dimethyldodec-4-enoyl)pyrrolidine-2-carbonyl]oxy-3-methylpentanoyl]oxypropanoic acid
| Internal ID | eee5bb00-b670-4652-9070-994aa64206ba |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides |
| IUPAC Name | 2-[2-[1-(3-hydroxy-2,4-dimethyldodec-4-enoyl)pyrrolidine-2-carbonyl]oxy-3-methylpentanoyl]oxypropanoic acid |
| SMILES (Canonical) | CCCCCCCC=C(C)C(C(C)C(=O)N1CCCC1C(=O)OC(C(C)CC)C(=O)OC(C)C(=O)O)O |
| SMILES (Isomeric) | CCCCCCCC=C(C)C(C(C)C(=O)N1CCCC1C(=O)OC(C(C)CC)C(=O)OC(C)C(=O)O)O |
| InChI | InChI=1S/C28H47NO8/c1-7-9-10-11-12-13-15-19(4)23(30)20(5)25(31)29-17-14-16-22(29)27(34)37-24(18(3)8-2)28(35)36-21(6)26(32)33/h15,18,20-24,30H,7-14,16-17H2,1-6H3,(H,32,33) |
| InChI Key | HYPDCGGBAFGHKA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H47NO8 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.33016746 g/mol |
| Topological Polar Surface Area (TPSA) | 130.00 Ų |
| XlogP | 6.30 |
| Atomic LogP (AlogP) | 4.26 |
| H-Bond Acceptor | 7 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 16 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6894 | 68.94% |
| Caco-2 | - | 0.7284 | 72.84% |
| Blood Brain Barrier | + | 0.5500 | 55.00% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.6241 | 62.41% |
| OATP2B1 inhibitior | - | 0.7217 | 72.17% |
| OATP1B1 inhibitior | + | 0.8667 | 86.67% |
| OATP1B3 inhibitior | + | 0.9306 | 93.06% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.5839 | 58.39% |
| P-glycoprotein inhibitior | + | 0.6836 | 68.36% |
| P-glycoprotein substrate | + | 0.5081 | 50.81% |
| CYP3A4 substrate | + | 0.6380 | 63.80% |
| CYP2C9 substrate | - | 0.8101 | 81.01% |
| CYP2D6 substrate | - | 0.8677 | 86.77% |
| CYP3A4 inhibition | - | 0.8884 | 88.84% |
| CYP2C9 inhibition | - | 0.8118 | 81.18% |
| CYP2C19 inhibition | - | 0.7176 | 71.76% |
| CYP2D6 inhibition | - | 0.8627 | 86.27% |
| CYP1A2 inhibition | - | 0.7448 | 74.48% |
| CYP2C8 inhibition | + | 0.4873 | 48.73% |
| CYP inhibitory promiscuity | - | 0.6956 | 69.56% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.5407 | 54.07% |
| Eye corrosion | - | 0.9843 | 98.43% |
| Eye irritation | - | 0.9178 | 91.78% |
| Skin irritation | - | 0.7680 | 76.80% |
| Skin corrosion | - | 0.9384 | 93.84% |
| Ames mutagenesis | - | 0.7800 | 78.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6052 | 60.52% |
| Micronuclear | + | 0.6100 | 61.00% |
| Hepatotoxicity | + | 0.5542 | 55.42% |
| skin sensitisation | - | 0.8646 | 86.46% |
| Respiratory toxicity | + | 0.5556 | 55.56% |
| Reproductive toxicity | + | 0.5556 | 55.56% |
| Mitochondrial toxicity | + | 0.5250 | 52.50% |
| Nephrotoxicity | - | 0.7542 | 75.42% |
| Acute Oral Toxicity (c) | III | 0.6595 | 65.95% |
| Estrogen receptor binding | + | 0.7116 | 71.16% |
| Androgen receptor binding | + | 0.6404 | 64.04% |
| Thyroid receptor binding | - | 0.6129 | 61.29% |
| Glucocorticoid receptor binding | + | 0.6470 | 64.70% |
| Aromatase binding | - | 0.5322 | 53.22% |
| PPAR gamma | - | 0.5970 | 59.70% |
| Honey bee toxicity | - | 0.8961 | 89.61% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | + | 0.5689 | 56.89% |
| Fish aquatic toxicity | + | 0.9541 | 95.41% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.11% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.56% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 95.73% | 95.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.34% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.24% | 93.56% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 93.37% | 92.12% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 93.35% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.66% | 99.17% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.45% | 92.86% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.88% | 96.47% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 90.77% | 98.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.14% | 96.95% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 89.95% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.72% | 100.00% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 89.70% | 90.65% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.54% | 99.18% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.15% | 97.21% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.45% | 91.19% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.38% | 97.29% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.32% | 92.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.92% | 95.89% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.71% | 94.66% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.57% | 94.45% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.93% | 90.24% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.30% | 91.81% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 84.84% | 98.24% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.71% | 96.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 84.61% | 97.47% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.57% | 97.50% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.55% | 95.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.32% | 95.50% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 83.85% | 94.05% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.57% | 96.00% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 83.44% | 95.52% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.06% | 94.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.83% | 97.09% |
| CHEMBL4683 | Q12884 | Fibroblast activation protein alpha | 82.74% | 93.07% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.74% | 96.38% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.56% | 82.38% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.54% | 93.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.45% | 93.03% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.09% | 98.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.92% | 90.71% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 80.59% | 98.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73836735 |
| LOTUS | LTS0269300 |
| wikiData | Q104168524 |