methyl (12R,21R,24R)-21-hydroxy-20-oxo-5,7-dioxa-2,15-diazaheptacyclo[17.2.2.112,15.01,12.03,11.04,8.019,24]tetracosa-3(11),4(8),9-triene-21-carboxylate
Internal ID | 359f1db5-034c-475f-8846-a40d358a0049 |
Taxonomy | Alkaloids and derivatives > Aspidofractine alkaloids |
IUPAC Name | methyl (12R,21R,24R)-21-hydroxy-20-oxo-5,7-dioxa-2,15-diazaheptacyclo[17.2.2.112,15.01,12.03,11.04,8.019,24]tetracosa-3(11),4(8),9-triene-21-carboxylate |
SMILES (Canonical) | COC(=O)C1(C(=O)C23CCCN4C2C5(C1(CC3)NC6=C5C=CC7=C6OCO7)CC4)O |
SMILES (Isomeric) | COC(=O)[C@@]1(C(=O)C23CCCN4[C@@H]2[C@@]5(C1(CC3)NC6=C5C=CC7=C6OCO7)CC4)O |
InChI | InChI=1S/C22H24N2O6/c1-28-18(26)22(27)17(25)19-5-2-9-24-10-8-20(16(19)24)12-3-4-13-15(30-11-29-13)14(12)23-21(20,22)7-6-19/h3-4,16,23,27H,2,5-11H2,1H3/t16-,19?,20+,21?,22+/m0/s1 |
InChI Key | JVVDRTHBTYJZSQ-DBBMPCLKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24N2O6 |
Molecular Weight | 412.40 g/mol |
Exact Mass | 412.16343649 g/mol |
Topological Polar Surface Area (TPSA) | 97.30 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of methyl (12R,21R,24R)-21-hydroxy-20-oxo-5,7-dioxa-2,15-diazaheptacyclo[17.2.2.112,15.01,12.03,11.04,8.019,24]tetracosa-3(11),4(8),9-triene-21-carboxylate 2D Structure of methyl (12R,21R,24R)-21-hydroxy-20-oxo-5,7-dioxa-2,15-diazaheptacyclo[17.2.2.112,15.01,12.03,11.04,8.019,24]tetracosa-3(11),4(8),9-triene-21-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/2bcd3ac0-857c-11ee-a367-fb6ced238c13.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.72% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.91% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.39% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.12% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 94.94% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.53% | 95.56% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.60% | 83.82% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.08% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.68% | 90.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.33% | 97.28% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.08% | 86.33% |
CHEMBL5028 | O14672 | ADAM10 | 86.44% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.40% | 95.89% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.33% | 85.30% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.27% | 94.42% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.31% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.28% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.25% | 92.62% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.12% | 90.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.66% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kopsia singapurensis |
PubChem | 101864236 |
LOTUS | LTS0148527 |
wikiData | Q105135978 |