2-[2-[(26Z)-26-ethylidene-29-(1-hydroxyethyl)-19-(2-hydroxypropan-2-yl)-12-(1-methoxyethyl)-14,21,28,31-tetraoxo-10,17,24,34-tetrathia-6,13,20,27,30,35,36,37,38-nonazahexacyclo[30.2.1.18,11.115,18.122,25.02,7]octatriaconta-1(35),2(7),3,5,8,11(38),15,18(37),22,25(36),32-undecaen-5-yl]-1,3-thiazol-4-yl]-N-[(E)-1-oxo-1-(2-oxopropylamino)but-2-en-2-yl]-1,3-thiazole-4-carboxamide
| Internal ID | 165a74b0-6cd0-4724-a77d-885f09f11783 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
| IUPAC Name | 2-[2-[(26Z)-26-ethylidene-29-(1-hydroxyethyl)-19-(2-hydroxypropan-2-yl)-12-(1-methoxyethyl)-14,21,28,31-tetraoxo-10,17,24,34-tetrathia-6,13,20,27,30,35,36,37,38-nonazahexacyclo[30.2.1.18,11.115,18.122,25.02,7]octatriaconta-1(35),2(7),3,5,8,11(38),15,18(37),22,25(36),32-undecaen-5-yl]-1,3-thiazol-4-yl]-N-[(E)-1-oxo-1-(2-oxopropylamino)but-2-en-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES (Canonical) | CC=C1C2=NC(=CS2)C(=O)NC(C3=NC(=CS3)C(=O)NC(C4=NC(=CS4)C5=C(C=CC(=N5)C6=NC(=CS6)C7=NC(=CS7)C(=O)NC(=CC)C(=O)NCC(=O)C)C8=NC(=CS8)C(=O)NC(C(=O)N1)C(C)O)C(C)OC)C(C)(C)O |
| SMILES (Isomeric) | C/C=C\1/C2=NC(=CS2)C(=O)NC(C3=NC(=CS3)C(=O)NC(C4=NC(=CS4)C5=C(C=CC(=N5)C6=NC(=CS6)C7=NC(=CS7)C(=O)N/C(=C/C)/C(=O)NCC(=O)C)C8=NC(=CS8)C(=O)NC(C(=O)N1)C(C)O)C(C)OC)C(C)(C)O |
| InChI | InChI=1S/C49H49N13O10S6/c1-9-24(37(65)50-13-20(3)63)52-38(66)28-16-75-46(57-28)32-19-76-45(59-32)26-12-11-23-35(51-26)27-14-77-47(54-27)34(22(5)72-8)61-40(68)30-18-78-48(58-30)36(49(6,7)71)62-41(69)31-17-74-44(56-31)25(10-2)53-42(70)33(21(4)64)60-39(67)29-15-73-43(23)55-29/h9-12,14-19,21-22,33-34,36,64,71H,13H2,1-8H3,(H,50,65)(H,52,66)(H,53,70)(H,60,67)(H,61,68)(H,62,69)/b24-9+,25-10- |
| InChI Key | DOYFHLROJAEHDR-BCTCXFRGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C49H49N13O10S6 |
| Molecular Weight | 1172.40 g/mol |
| Exact Mass | 1171.20496185 g/mol |
| Topological Polar Surface Area (TPSA) | 501.00 Ų |
| XlogP | 3.70 |
| RefChem:195685 |
| YM266184 |
| YM 266184 |
| SCHEMBL30083772 |
| CHEBI:203980 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.54% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.10% | 91.11% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 97.95% | 93.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 95.76% | 89.34% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 95.37% | 95.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.09% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.81% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.73% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.51% | 94.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 89.99% | 92.88% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.91% | 96.90% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 89.89% | 83.10% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.70% | 94.73% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.73% | 94.75% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 88.31% | 97.53% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.09% | 98.59% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 87.52% | 95.56% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.99% | 91.24% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 86.71% | 92.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.64% | 90.17% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 86.08% | 80.71% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.30% | 89.67% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.79% | 89.63% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.76% | 92.62% |
| CHEMBL1801 | P00747 | Plasminogen | 83.37% | 92.44% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.05% | 95.64% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.04% | 96.67% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.83% | 91.07% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.80% | 85.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.71% | 93.56% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 81.06% | 81.58% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.29% | 98.05% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.20% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.08% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101237084 |
| LOTUS | LTS0129794 |
| wikiData | Q77382550 |