(2S,3R,4R,5S,6S)-2-[(2S,3R,4S,5S,6R)-2-(3,4-dimethoxyphenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-4-methoxy-6-methyloxane-3,5-diol
Internal ID | 2acdba41-eff6-474b-adce-7208f677b1cd |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (2S,3R,4R,5S,6S)-2-[(2S,3R,4S,5S,6R)-2-(3,4-dimethoxyphenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-4-methoxy-6-methyloxane-3,5-diol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C(C=C3)OC)OC)CO)O)O)O)OC)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=CC(=C(C=C3)OC)OC)CO)O)O)O)OC)O |
InChI | InChI=1S/C21H32O12/c1-9-14(23)18(29-4)17(26)20(30-9)33-19-16(25)15(24)13(8-22)32-21(19)31-10-5-6-11(27-2)12(7-10)28-3/h5-7,9,13-26H,8H2,1-4H3/t9-,13+,14-,15+,16-,17+,18+,19+,20-,21+/m0/s1 |
InChI Key | QLXUNALFIPIVMX-IHGNBAIASA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H32O12 |
Molecular Weight | 476.50 g/mol |
Exact Mass | 476.18937645 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5S,6S)-2-[(2S,3R,4S,5S,6R)-2-(3,4-dimethoxyphenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-4-methoxy-6-methyloxane-3,5-diol 2D Structure of (2S,3R,4R,5S,6S)-2-[(2S,3R,4S,5S,6R)-2-(3,4-dimethoxyphenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-4-methoxy-6-methyloxane-3,5-diol](https://plantaedb.com/storage/docs/compounds/2023/11/2bb40350-86cf-11ee-a4d6-395bf50a993c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.36% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.30% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.75% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.79% | 92.94% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.85% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.55% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.90% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.83% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.42% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.18% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.78% | 86.92% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.32% | 91.49% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.62% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.50% | 89.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.49% | 97.53% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.39% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 81.01% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.23% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picea abies |
PubChem | 101929526 |
LOTUS | LTS0217087 |
wikiData | Q105223837 |