[6-[7-[4-[6-(Acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | a9edd56e-489e-4074-9d46-51447004d073 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid 3-O-p-coumaroyl glycosides |
IUPAC Name | [6-[7-[4-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=C3)OC(=C(C4=O)OC5C(C(C(C(O5)COC(=O)C=CC6=CC(=C(C=C6)O)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)C8=CC=C(C=C8)O)O)CO)O)OC9C(C(C(C(O9)COC(=O)C)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=C3)OC(=C(C4=O)OC5C(C(C(C(O5)COC(=O)C=CC6=CC(=C(C=C6)O)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)C8=CC=C(C=C8)O)O)CO)O)OC9C(C(C(C(O9)COC(=O)C)O)O)O)O)O)O |
InChI | InChI=1S/C56H68O34/c1-18-34(65)40(71)44(75)52(80-18)90-51-48(87-54-46(77)42(73)36(67)30(85-54)16-78-19(2)59)38(69)29(15-58)84-56(51)81-23-12-26(63)33-27(13-23)82-47(21-5-7-22(60)8-6-21)49(39(33)70)88-55-50(89-53-45(76)41(72)35(66)28(14-57)83-53)43(74)37(68)31(86-55)17-79-32(64)10-4-20-3-9-24(61)25(62)11-20/h3-13,18,28-31,34-38,40-46,48,50-58,60-63,65-69,71-77H,14-17H2,1-2H3 |
InChI Key | HTVWZHKNEHKTEG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C56H68O34 |
Molecular Weight | 1285.10 g/mol |
Exact Mass | 1284.3591992 g/mol |
Topological Polar Surface Area (TPSA) | 535.00 Ų |
XlogP | -4.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.97% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.88% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 99.17% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.63% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 96.16% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.62% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.28% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.95% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.77% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 91.55% | 90.71% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.83% | 94.80% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.90% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.36% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.01% | 99.15% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.41% | 95.64% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.68% | 94.45% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.90% | 95.78% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.49% | 95.56% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.91% | 93.10% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.12% | 97.36% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.76% | 86.92% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.50% | 80.78% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.68% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.40% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aucklandia costus |
PubChem | 162872430 |
LOTUS | LTS0147418 |
wikiData | Q105033644 |