2-[3,18-Bis(2-amino-2-oxoethyl)-15,21-di(ethylidene)-27-hydroxy-6-(1-hydroxyethyl)-4,9-dimethyl-2,5,8,11,14,17,20,23,26,30-decaoxo-28-(12-oxotetradecan-2-yl)-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29-decazabicyclo[29.3.0]tetratriacontan-12-yl]acetamide
| Internal ID | b467067f-8225-4b35-9e70-db185218fd51 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | 2-[3,18-bis(2-amino-2-oxoethyl)-15,21-di(ethylidene)-27-hydroxy-6-(1-hydroxyethyl)-4,9-dimethyl-2,5,8,11,14,17,20,23,26,30-decaoxo-28-(12-oxotetradecan-2-yl)-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29-decazabicyclo[29.3.0]tetratriacontan-12-yl]acetamide |
| SMILES (Canonical) | CCC(=O)CCCCCCCCCC(C)C1C(C(=O)NC(C(=O)NC(=CC)C(=O)NC(C(=O)NC(=CC)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N1)CC(=O)N)C)C(C)O)C)CC(=O)N)CC(=O)N)C(C)C)O |
| SMILES (Isomeric) | CCC(=O)CCCCCCCCCC(C)C1C(C(=O)NC(C(=O)NC(=CC)C(=O)NC(C(=O)NC(=CC)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N1)CC(=O)N)C)C(C)O)C)CC(=O)N)CC(=O)N)C(C)C)O |
| InChI | InChI=1S/C55H89N13O16/c1-10-32(70)22-19-17-15-13-14-16-18-21-29(6)43-45(74)53(82)64-42(28(4)5)52(81)61-34(12-3)48(77)63-36(26-40(57)72)50(79)60-33(11-2)47(76)62-35(25-39(56)71)49(78)59-30(7)46(75)66-44(31(8)69)55(84)67(9)38(27-41(58)73)54(83)68-24-20-23-37(68)51(80)65-43/h11-12,28-31,35-38,42-45,69,74H,10,13-27H2,1-9H3,(H2,56,71)(H2,57,72)(H2,58,73)(H,59,78)(H,60,79)(H,61,81)(H,62,76)(H,63,77)(H,64,82)(H,65,80)(H,66,75) |
| InChI Key | HZHLPFLQTJCCHS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C55H89N13O16 |
| Molecular Weight | 1188.40 g/mol |
| Exact Mass | 1187.65502380 g/mol |
| Topological Polar Surface Area (TPSA) | 460.00 Ų |
| XlogP | -0.90 |
| Atomic LogP (AlogP) | -3.06 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6729 | 67.29% |
| Caco-2 | - | 0.8625 | 86.25% |
| Blood Brain Barrier | - | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.8143 | 81.43% |
| Subcellular localzation | Mitochondria | 0.5864 | 58.64% |
| OATP2B1 inhibitior | - | 0.8606 | 86.06% |
| OATP1B1 inhibitior | + | 0.8201 | 82.01% |
| OATP1B3 inhibitior | + | 0.8828 | 88.28% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.8817 | 88.17% |
| BSEP inhibitior | + | 0.9407 | 94.07% |
| P-glycoprotein inhibitior | + | 0.7428 | 74.28% |
| P-glycoprotein substrate | + | 0.8777 | 87.77% |
| CYP3A4 substrate | + | 0.7247 | 72.47% |
| CYP2C9 substrate | - | 0.7898 | 78.98% |
| CYP2D6 substrate | - | 0.8680 | 86.80% |
| CYP3A4 inhibition | - | 0.9007 | 90.07% |
| CYP2C9 inhibition | - | 0.8760 | 87.60% |
| CYP2C19 inhibition | - | 0.8830 | 88.30% |
| CYP2D6 inhibition | - | 0.9347 | 93.47% |
| CYP1A2 inhibition | - | 0.8718 | 87.18% |
| CYP2C8 inhibition | + | 0.6778 | 67.78% |
| CYP inhibitory promiscuity | - | 0.9912 | 99.12% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8800 | 88.00% |
| Carcinogenicity (trinary) | Non-required | 0.5515 | 55.15% |
| Eye corrosion | - | 0.9855 | 98.55% |
| Eye irritation | - | 0.8970 | 89.70% |
| Skin irritation | - | 0.7609 | 76.09% |
| Skin corrosion | - | 0.8998 | 89.98% |
| Ames mutagenesis | - | 0.7537 | 75.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6499 | 64.99% |
| Micronuclear | + | 0.7700 | 77.00% |
| Hepatotoxicity | + | 0.5125 | 51.25% |
| skin sensitisation | - | 0.8639 | 86.39% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | - | 0.7793 | 77.93% |
| Acute Oral Toxicity (c) | III | 0.6591 | 65.91% |
| Estrogen receptor binding | + | 0.7275 | 72.75% |
| Androgen receptor binding | + | 0.7177 | 71.77% |
| Thyroid receptor binding | + | 0.5404 | 54.04% |
| Glucocorticoid receptor binding | + | 0.6334 | 63.34% |
| Aromatase binding | + | 0.7300 | 73.00% |
| PPAR gamma | + | 0.7682 | 76.82% |
| Honey bee toxicity | - | 0.7442 | 74.42% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.5376 | 53.76% |
| Fish aquatic toxicity | + | 0.7030 | 70.30% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 99.73% | 95.92% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.59% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.56% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 98.11% | 94.75% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.22% | 90.08% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.17% | 83.82% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 96.53% | 96.31% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.09% | 94.66% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.66% | 96.47% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 95.30% | 93.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.51% | 90.71% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 94.28% | 82.38% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 94.02% | 95.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.24% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.77% | 91.11% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 92.34% | 92.12% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 92.29% | 97.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.08% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.93% | 95.56% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 91.48% | 94.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.04% | 97.25% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.57% | 95.71% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.14% | 93.03% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 89.09% | 97.47% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.55% | 95.50% |
| CHEMBL3837 | P07711 | Cathepsin L | 88.50% | 96.61% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.51% | 90.17% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.49% | 100.00% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 87.06% | 95.27% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.97% | 94.45% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.80% | 95.56% |
| CHEMBL1949 | P62937 | Cyclophilin A | 86.45% | 98.57% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.38% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 86.00% | 96.03% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.65% | 97.64% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.48% | 85.14% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 85.40% | 99.29% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.86% | 98.33% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 84.79% | 97.63% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.73% | 98.75% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.35% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.27% | 93.56% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.85% | 90.24% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.80% | 89.00% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 82.38% | 94.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.15% | 99.17% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.05% | 97.50% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 82.03% | 95.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.88% | 99.18% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.60% | 99.23% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.60% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.31% | 92.86% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.04% | 89.50% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.58% | 88.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 76032394 |
| LOTUS | LTS0264029 |
| wikiData | Q104168542 |