5,7,10-Trihydroxy-2-(2-hydroxypropan-2-yl)-4-(3-methylbut-2-enyl)-1,2-dihydrofuro[2,3-c]xanthen-6-one
| Internal ID | 181a0bf8-51e9-48ae-a55b-2f280e1952dc |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > 2-prenylated xanthones |
| IUPAC Name | 5,7,10-trihydroxy-2-(2-hydroxypropan-2-yl)-4-(3-methylbut-2-enyl)-1,2-dihydrofuro[2,3-c]xanthen-6-one |
| SMILES (Canonical) | CC(=CCC1=C2C(=C3C(=C1O)C(=O)C4=C(C=CC(=C4O3)O)O)CC(O2)C(C)(C)O)C |
| SMILES (Isomeric) | CC(=CCC1=C2C(=C3C(=C1O)C(=O)C4=C(C=CC(=C4O3)O)O)CC(O2)C(C)(C)O)C |
| InChI | InChI=1S/C23H24O7/c1-10(2)5-6-11-18(26)17-19(27)16-13(24)7-8-14(25)22(16)30-21(17)12-9-15(23(3,4)28)29-20(11)12/h5,7-8,15,24-26,28H,6,9H2,1-4H3 |
| InChI Key | MAMGYTJNIKXGLJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15220310 g/mol |
| Topological Polar Surface Area (TPSA) | 116.00 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of 5,7,10-Trihydroxy-2-(2-hydroxypropan-2-yl)-4-(3-methylbut-2-enyl)-1,2-dihydrofuro[2,3-c]xanthen-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/2b12ee60-8529-11ee-b09a-390188169f5c.jpg "2D Structure of 5,7,10-Trihydroxy-2-(2-hydroxypropan-2-yl)-4-(3-methylbut-2-enyl)-1,2-dihydrofuro[2,3-c]xanthen-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.57% | 91.11% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 98.32% | 89.34% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.14% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.60% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.02% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.40% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.44% | 95.56% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 88.41% | 85.30% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.02% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.53% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.10% | 86.33% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.91% | 98.11% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 84.26% | 96.37% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.67% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.23% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Morus insignis |
| PubChem | 21591067 |
| LOTUS | LTS0263370 |
| wikiData | Q105160421 |