5-[(2S,3R,4R,5S)-4-[(2R,3R)-3-(3,5-dihydroxyphenyl)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-4-yl]-2-(3-hydroxyphenyl)-5-(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol
Internal ID | 2d997374-0b68-429d-afd1-31f09f0e41ee |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 5-[(2S,3R,4R,5S)-4-[(2R,3R)-3-(3,5-dihydroxyphenyl)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-4-yl]-2-(3-hydroxyphenyl)-5-(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol |
SMILES (Canonical) | C1=CC(=CC(=C1)O)C2C(C(C(O2)C3=CC=C(C=C3)O)C4=C5C(C(OC5=CC(=C4)O)C6=CC=C(C=C6)O)C7=CC(=CC(=C7)O)O)C8=CC(=CC(=C8)O)O |
SMILES (Isomeric) | C1=CC(=CC(=C1)O)[C@@H]2[C@H]([C@@H]([C@H](O2)C3=CC=C(C=C3)O)C4=C5[C@H]([C@@H](OC5=CC(=C4)O)C6=CC=C(C=C6)O)C7=CC(=CC(=C7)O)O)C8=CC(=CC(=C8)O)O |
InChI | InChI=1S/C42H34O10/c43-26-8-4-21(5-9-26)40-36(24-13-29(46)17-30(47)14-24)38-34(19-33(50)20-35(38)51-40)39-37(25-15-31(48)18-32(49)16-25)42(23-2-1-3-28(45)12-23)52-41(39)22-6-10-27(44)11-7-22/h1-20,36-37,39-50H/t36-,37+,39+,40+,41-,42-/m1/s1 |
InChI Key | MGWFFACWUBVZPP-JSRSTUMASA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H34O10 |
Molecular Weight | 698.70 g/mol |
Exact Mass | 698.21519728 g/mol |
Topological Polar Surface Area (TPSA) | 180.00 Ų |
XlogP | 6.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.13% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.69% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.05% | 99.15% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.43% | 93.40% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.88% | 89.00% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 84.59% | 97.64% |
CHEMBL2581 | P07339 | Cathepsin D | 84.41% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.28% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.06% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.51% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.06% | 86.33% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.96% | 85.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.84% | 95.93% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.41% | 83.57% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 80.11% | 96.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Welwitschia mirabilis |
PubChem | 163041631 |
LOTUS | LTS0092465 |
wikiData | Q105163612 |