(2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-6-[(1S,2S,3'S,4S,5'R,6S,7S,8R,9S,12S,13R,16S)-3'-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-2-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | e9c623f5-7f1f-4751-8671-90114fd88cf1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-6-[(1S,2S,3'S,4S,5'R,6S,7S,8R,9S,12S,13R,16S)-3'-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-2-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)C)O)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC19C(CC(CN9)CO)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@@H]([C@H]([C@@H](O7)C)O)O)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)C)C)O[C@]19[C@H](C[C@H](CN9)CO)O |
InChI | InChI=1S/C45H73NO17/c1-18-30-27(63-45(18)29(49)12-21(16-47)15-46-45)14-26-24-7-6-22-13-23(8-10-43(22,4)25(24)9-11-44(26,30)5)59-42-39(62-41-36(55)34(53)32(51)20(3)58-41)37(56)38(28(17-48)60-42)61-40-35(54)33(52)31(50)19(2)57-40/h6,18-21,23-42,46-56H,7-17H2,1-5H3/t18-,19-,20-,21+,23-,24+,25-,26-,27-,28+,29-,30-,31-,32-,33+,34+,35+,36+,37-,38+,39+,40-,41-,42+,43-,44-,45-/m0/s1 |
InChI Key | VNISUUJOAPABTP-HQYSTUFRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H73NO17 |
Molecular Weight | 900.10 g/mol |
Exact Mass | 899.48784986 g/mol |
Topological Polar Surface Area (TPSA) | 279.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.09% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.25% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.20% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.54% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.03% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.52% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.12% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.39% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.02% | 94.00% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 89.34% | 95.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.18% | 89.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.97% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.85% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.43% | 95.89% |
CHEMBL237 | P41145 | Kappa opioid receptor | 88.08% | 98.10% |
CHEMBL2581 | P07339 | Cathepsin D | 87.39% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.71% | 94.75% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.54% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.37% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.00% | 92.94% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.69% | 96.21% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.02% | 96.43% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.99% | 95.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.24% | 93.04% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.24% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum donianum |
PubChem | 21636348 |
LOTUS | LTS0191835 |
wikiData | Q105289657 |