(2R)-N-[(E,2S,3S,4R)-3,4-dihydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadec-8-en-2-yl]-2-hydroxypentacosanamide
Internal ID | 5e17a8f4-bbb5-4fde-91d7-e8d37387af5c |
Taxonomy | Lipids and lipid-like molecules > Sphingolipids > Glycosphingolipids |
IUPAC Name | (2R)-N-[(E,2S,3S,4R)-3,4-dihydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadec-8-en-2-yl]-2-hydroxypentacosanamide |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCCCCCC(C(=O)NC(COC1C(C(C(C(O1)CO)O)O)O)C(C(CCCC=CCCCCCCCCC)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCCCCC[C@H](C(=O)N[C@@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)[C@@H]([C@@H](CCC/C=C/CCCCCCCCC)O)O)O |
InChI | InChI=1S/C49H95NO10/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-27-29-31-33-35-37-42(53)48(58)50-40(39-59-49-47(57)46(56)45(55)43(38-51)60-49)44(54)41(52)36-34-32-30-28-26-16-14-12-10-8-6-4-2/h28,30,40-47,49,51-57H,3-27,29,31-39H2,1-2H3,(H,50,58)/b30-28+/t40-,41+,42+,43+,44-,45+,46-,47+,49+/m0/s1 |
InChI Key | JPDBHJZMCPAOTJ-DZTHZXGQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C49H95NO10 |
Molecular Weight | 858.30 g/mol |
Exact Mass | 857.69559823 g/mol |
Topological Polar Surface Area (TPSA) | 189.00 Ų |
XlogP | 13.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.70% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 98.56% | 98.95% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.66% | 97.29% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.60% | 92.86% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.20% | 96.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.98% | 93.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.07% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.92% | 94.73% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.76% | 92.50% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.20% | 92.08% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.63% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.27% | 96.47% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.86% | 83.82% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.85% | 91.24% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.04% | 94.33% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.48% | 89.34% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.34% | 96.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.56% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.95% | 96.95% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.85% | 91.81% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.35% | 98.05% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.21% | 82.50% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.19% | 95.58% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 83.59% | 94.66% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 82.60% | 85.94% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.08% | 95.71% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.89% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.75% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.57% | 95.89% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.19% | 92.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 60163118 |
LOTUS | LTS0107207 |
wikiData | Q105132654 |