4-(Hydroxymethyl)-5,6-dimethoxy-3-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-4,8,10,12,14,19,21,23,25,27-decaen-18-one
Internal ID | 5990831f-2ff1-49a3-bd42-9b66181be8ff |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles > Pyrrolocarbazoles > Indolocarbazoles |
IUPAC Name | 4-(hydroxymethyl)-5,6-dimethoxy-3-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-4,8,10,12,14,19,21,23,25,27-decaen-18-one |
SMILES (Canonical) | COC1=C(OC2CC1(N3C4=CC=CC=C4C5=C6CNC(=O)C6=C7C8=CC=CC=C8N2C7=C53)OC)CO |
SMILES (Isomeric) | COC1=C(OC2CC1(N3C4=CC=CC=C4C5=C6CNC(=O)C6=C7C8=CC=CC=C8N2C7=C53)OC)CO |
InChI | InChI=1S/C28H23N3O5/c1-34-26-19(13-32)36-20-11-28(26,35-2)31-18-10-6-4-8-15(18)21-16-12-29-27(33)23(16)22-14-7-3-5-9-17(14)30(20)24(22)25(21)31/h3-10,20,32H,11-13H2,1-2H3,(H,29,33) |
InChI Key | BORNSRKIOQKELD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H23N3O5 |
Molecular Weight | 481.50 g/mol |
Exact Mass | 481.16377084 g/mol |
Topological Polar Surface Area (TPSA) | 86.90 Ų |
XlogP | 2.60 |
Atomic LogP (AlogP) | 4.23 |
H-Bond Acceptor | 7 |
H-Bond Donor | 2 |
Rotatable Bonds | 3 |
There are no found synonyms. |
![2D Structure of 4-(Hydroxymethyl)-5,6-dimethoxy-3-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-4,8,10,12,14,19,21,23,25,27-decaen-18-one 2D Structure of 4-(Hydroxymethyl)-5,6-dimethoxy-3-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-4,8,10,12,14,19,21,23,25,27-decaen-18-one](https://plantaedb.com/storage/docs/compounds/2023/11/2a6c79a0-81d9-11ee-b347-ff7610b81c40.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8305 | 83.05% |
Caco-2 | - | 0.6587 | 65.87% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | - | 0.5571 | 55.71% |
Subcellular localzation | Mitochondria | 0.4323 | 43.23% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9014 | 90.14% |
OATP1B3 inhibitior | + | 0.9369 | 93.69% |
MATE1 inhibitior | - | 0.8400 | 84.00% |
OCT2 inhibitior | - | 0.7500 | 75.00% |
BSEP inhibitior | + | 0.9839 | 98.39% |
P-glycoprotein inhibitior | + | 0.8265 | 82.65% |
P-glycoprotein substrate | + | 0.7750 | 77.50% |
CYP3A4 substrate | + | 0.6697 | 66.97% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8603 | 86.03% |
CYP3A4 inhibition | - | 0.6396 | 63.96% |
CYP2C9 inhibition | - | 0.7331 | 73.31% |
CYP2C19 inhibition | - | 0.7845 | 78.45% |
CYP2D6 inhibition | - | 0.9019 | 90.19% |
CYP1A2 inhibition | - | 0.7700 | 77.00% |
CYP2C8 inhibition | + | 0.5847 | 58.47% |
CYP inhibitory promiscuity | + | 0.5000 | 50.00% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9500 | 95.00% |
Carcinogenicity (trinary) | Non-required | 0.6152 | 61.52% |
Eye corrosion | - | 0.9885 | 98.85% |
Eye irritation | - | 0.9529 | 95.29% |
Skin irritation | - | 0.7825 | 78.25% |
Skin corrosion | - | 0.9379 | 93.79% |
Ames mutagenesis | + | 0.6582 | 65.82% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3789 | 37.89% |
Micronuclear | + | 0.8200 | 82.00% |
Hepatotoxicity | + | 0.5823 | 58.23% |
skin sensitisation | - | 0.8695 | 86.95% |
Respiratory toxicity | + | 0.8444 | 84.44% |
Reproductive toxicity | + | 0.9333 | 93.33% |
Mitochondrial toxicity | + | 0.9125 | 91.25% |
Nephrotoxicity | - | 0.7237 | 72.37% |
Acute Oral Toxicity (c) | III | 0.5648 | 56.48% |
Estrogen receptor binding | + | 0.7463 | 74.63% |
Androgen receptor binding | + | 0.6452 | 64.52% |
Thyroid receptor binding | + | 0.5909 | 59.09% |
Glucocorticoid receptor binding | + | 0.7784 | 77.84% |
Aromatase binding | + | 0.6890 | 68.90% |
PPAR gamma | + | 0.7451 | 74.51% |
Honey bee toxicity | - | 0.8197 | 81.97% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | - | 0.5200 | 52.00% |
Fish aquatic toxicity | - | 0.3830 | 38.30% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.89% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.89% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.54% | 96.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 98.43% | 93.99% |
CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 97.42% | 81.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.09% | 94.45% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 96.53% | 80.71% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 96.24% | 83.10% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 95.69% | 87.16% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.15% | 95.56% |
CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 94.78% | 81.58% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.57% | 89.00% |
CHEMBL4924 | Q9UK32 | Ribosomal protein S6 kinase alpha 6 | 93.45% | 80.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.57% | 98.95% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 92.40% | 90.95% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 92.21% | 95.83% |
CHEMBL4599 | Q07912 | Tyrosine kinase non-receptor protein 2 | 91.94% | 94.29% |
CHEMBL2801 | Q13557 | CaM kinase II delta | 90.74% | 84.49% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 90.66% | 85.11% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 90.52% | 80.00% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 90.40% | 88.81% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 90.36% | 89.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.29% | 95.89% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.18% | 91.79% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.04% | 93.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.28% | 97.09% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.19% | 90.08% |
CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 89.17% | 91.83% |
CHEMBL3820 | P35557 | Hexokinase type IV | 88.31% | 91.96% |
CHEMBL4598 | Q13043 | Serine/threonine-protein kinase MST1 | 88.14% | 96.64% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.54% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.54% | 94.00% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 87.44% | 98.59% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.98% | 88.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.47% | 86.33% |
CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 86.26% | 89.32% |
CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 86.17% | 96.00% |
CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 85.51% | 90.48% |
CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 85.36% | 83.65% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 84.81% | 88.00% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 83.76% | 96.47% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.38% | 92.67% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 80.95% | 98.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.73% | 97.25% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.39% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hypericum ellipticum |
PubChem | 72501071 |
LOTUS | LTS0136003 |
wikiData | Q105112347 |