methyl (2Z)-2-[(1R,13E,18S,19S,21R,22S,23R,24R,26S,28R,29S,30R,33R,36R)-18,24,30-trihydroxy-14,22,29-trimethyl-3,7,10,15,31-pentaoxo-2,6,11,16-tetraoxanonacyclo[16.15.3.125,29.01,23.04,34.019,21.022,36.026,28.033,37]heptatriaconta-4(34),13,25(37)-trien-32-ylidene]propanoate
Internal ID | 6d5d0218-b740-4188-8dea-895b00a23ffd |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl (2Z)-2-[(1R,13E,18S,19S,21R,22S,23R,24R,26S,28R,29S,30R,33R,36R)-18,24,30-trihydroxy-14,22,29-trimethyl-3,7,10,15,31-pentaoxo-2,6,11,16-tetraoxanonacyclo[16.15.3.125,29.01,23.04,34.019,21.022,36.026,28.033,37]heptatriaconta-4(34),13,25(37)-trien-32-ylidene]propanoate |
SMILES (Canonical) | CC1=CCOC(=O)CCC(=O)OCC2=C3CC4C(C5CC5C4(COC1=O)O)(C6C3(C7C8=C(C6O)C9CC9C8(C(C(=O)C7=C(C)C(=O)OC)O)C)OC2=O)C |
SMILES (Isomeric) | C/C/1=C\COC(=O)CCC(=O)OCC2=C3C[C@@H]4[C@]([C@@H]5C[C@@H]5[C@]4(COC1=O)O)([C@H]6[C@@]3([C@@H]\7C8=C([C@@H]6O)[C@H]9C[C@H]9[C@@]8([C@H](C(=O)/C7=C(/C)\C(=O)OC)O)C)OC2=O)C |
InChI | InChI=1S/C40H44O14/c1-15-8-9-51-24(41)6-7-25(42)52-13-18-20-12-23-37(3,21-11-22(21)39(23,49)14-53-34(15)46)32-30(43)27-17-10-19(17)38(4)28(27)29(40(20,32)54-36(18)48)26(31(44)33(38)45)16(2)35(47)50-5/h8,17,19,21-23,29-30,32-33,43,45,49H,6-7,9-14H2,1-5H3/b15-8+,26-16-/t17-,19+,21+,22-,23+,29-,30-,32-,33-,37-,38-,39-,40+/m0/s1 |
InChI Key | JTARRSXSYCCLKA-ZSNYSFAYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H44O14 |
Molecular Weight | 748.80 g/mol |
Exact Mass | 748.27310607 g/mol |
Topological Polar Surface Area (TPSA) | 209.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
![2D Structure of methyl (2Z)-2-[(1R,13E,18S,19S,21R,22S,23R,24R,26S,28R,29S,30R,33R,36R)-18,24,30-trihydroxy-14,22,29-trimethyl-3,7,10,15,31-pentaoxo-2,6,11,16-tetraoxanonacyclo[16.15.3.125,29.01,23.04,34.019,21.022,36.026,28.033,37]heptatriaconta-4(34),13,25(37)-trien-32-ylidene]propanoate 2D Structure of methyl (2Z)-2-[(1R,13E,18S,19S,21R,22S,23R,24R,26S,28R,29S,30R,33R,36R)-18,24,30-trihydroxy-14,22,29-trimethyl-3,7,10,15,31-pentaoxo-2,6,11,16-tetraoxanonacyclo[16.15.3.125,29.01,23.04,34.019,21.022,36.026,28.033,37]heptatriaconta-4(34),13,25(37)-trien-32-ylidene]propanoate](https://plantaedb.com/storage/docs/compounds/2023/11/29b76740-8649-11ee-8848-5bdc121e654a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.88% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.12% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.06% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.63% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.29% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.27% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 91.85% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.55% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.79% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 88.38% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.77% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.21% | 100.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 87.14% | 97.53% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.04% | 82.69% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 84.67% | 97.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.69% | 93.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.49% | 97.25% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.15% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.05% | 86.33% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.68% | 97.21% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.27% | 91.24% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.07% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chloranthus multistachys |
PubChem | 46834846 |
LOTUS | LTS0149383 |
wikiData | Q105134687 |