6-Methoxy-4',5,5',5',10,14-hexamethylspiro[16-oxatetracyclo[8.6.0.01,13.04,9]hexadeca-2,4(9),5,7-tetraene-15,2'-oxolane]-3'-ol
| Internal ID | d6e12c7f-2c62-4e5c-b623-4a85dab7434f |
| Taxonomy | Benzenoids > Naphthalenes |
| IUPAC Name | 6-methoxy-4',5,5',5',10,14-hexamethylspiro[16-oxatetracyclo[8.6.0.01,13.04,9]hexadeca-2,4(9),5,7-tetraene-15,2'-oxolane]-3'-ol |
| SMILES (Canonical) | CC1C2CCC3(C2(C=CC4=C3C=CC(=C4C)OC)OC15C(C(C(O5)(C)C)C)O)C |
| SMILES (Isomeric) | CC1C2CCC3(C2(C=CC4=C3C=CC(=C4C)OC)OC15C(C(C(O5)(C)C)C)O)C |
| InChI | InChI=1S/C25H34O4/c1-14-17-10-13-24-18(11-12-23(24,6)19(17)8-9-20(14)27-7)15(2)25(29-24)21(26)16(3)22(4,5)28-25/h8-10,13,15-16,18,21,26H,11-12H2,1-7H3 |
| InChI Key | XANOSTKMMIEIMI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.24570956 g/mol |
| Topological Polar Surface Area (TPSA) | 47.90 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
![2D Structure of 6-Methoxy-4',5,5',5',10,14-hexamethylspiro[16-oxatetracyclo[8.6.0.01,13.04,9]hexadeca-2,4(9),5,7-tetraene-15,2'-oxolane]-3'-ol](https://plantaedb.com/storage/docs/compounds/2023/11/29a09980-863b-11ee-8faf-e39702090a4f.jpg "2D Structure of 6-Methoxy-4',5,5',5',10,14-hexamethylspiro[16-oxatetracyclo[8.6.0.01,13.04,9]hexadeca-2,4(9),5,7-tetraene-15,2'-oxolane]-3'-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.59% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.04% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.03% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.90% | 97.09% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 88.56% | 89.05% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.39% | 95.56% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.82% | 96.43% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.72% | 89.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.35% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.52% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.28% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.05% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.66% | 89.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.52% | 100.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.10% | 90.24% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.52% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162925073 |
| LOTUS | LTS0191339 |
| wikiData | Q104200803 |