[(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 2-hydroxybenzoate
Internal ID | 7fccb55e-8198-4fbd-bfdc-fab36518cbf1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 2-hydroxybenzoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)(C(=O)C)O)C)OC(=O)C9=CC=CC=C9O)C)C)C)C)O)OC)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@@H]3OC)O[C@@H]4[C@H](O[C@H](C[C@@H]4OC)O[C@H]5CC[C@@]6([C@H]7C[C@H]([C@@]8([C@@](CC[C@@]8([C@@]7(CC=C6C5)O)O)(C(=O)C)O)C)OC(=O)C9=CC=CC=C9O)C)C)C)C)O)OC)O |
InChI | InChI=1S/C56H84O21/c1-27-44(59)49(68-11)45(60)51(72-27)77-48-30(4)71-43(25-38(48)67-10)76-47-29(3)70-42(24-37(47)66-9)75-46-28(2)69-41(23-36(46)65-8)73-33-17-18-52(6)32(22-33)16-19-55(63)39(52)26-40(74-50(61)34-14-12-13-15-35(34)58)53(7)54(62,31(5)57)20-21-56(53,55)64/h12-16,27-30,33,36-49,51,58-60,62-64H,17-26H2,1-11H3/t27-,28-,29-,30-,33+,36+,37+,38+,39-,40-,41+,42+,43+,44-,45-,46-,47-,48-,49+,51+,52+,53-,54-,55+,56-/m1/s1 |
InChI Key | WYKQROHHPVHQJF-LZLBOVLDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C56H84O21 |
Molecular Weight | 1093.30 g/mol |
Exact Mass | 1092.55050968 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 2-hydroxybenzoate 2D Structure of [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 2-hydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/290cf980-86e1-11ee-bfcc-1f0534499bb1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.87% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.49% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.40% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.44% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.59% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.03% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.41% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.34% | 89.00% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 89.11% | 95.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.41% | 91.07% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.79% | 95.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.69% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.07% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.57% | 97.14% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.40% | 83.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.63% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.02% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.52% | 91.19% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.11% | 97.33% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.50% | 94.62% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.01% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.40% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.36% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.79% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Araujia sericifera |
PubChem | 11018621 |
LOTUS | LTS0051107 |
wikiData | Q105322355 |