2,9-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol
| Internal ID | 56dade51-558f-44af-aba0-9920b274eee5 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 2,9-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC(=C3O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC(=C3O)OC |
| InChI | InChI=1S/C18H19NO3/c1-21-12-3-4-13-11(7-12)8-14-16-10(5-6-19-14)9-15(22-2)18(20)17(13)16/h3-4,7,9,14,19-20H,5-6,8H2,1-2H3 |
| InChI Key | HWVONPVVTWVSRH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 50.70 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of 2,9-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol](https://plantaedb.com/storage/docs/compounds/2023/11/29-dimethoxy-566a7-tetrahydro-4h-dibenzodegquinolin-1-ol.jpg "2D Structure of 2,9-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.34% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.13% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.17% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.49% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.92% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.03% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.75% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.41% | 92.94% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 91.77% | 91.79% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 90.99% | 91.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.72% | 95.56% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.91% | 88.48% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.91% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.73% | 86.33% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.06% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.72% | 94.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.97% | 91.03% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.40% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.95% | 98.75% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 83.57% | 95.55% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.06% | 92.62% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.79% | 96.21% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.11% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ocotea caesia |
| PubChem | 163023620 |
| LOTUS | LTS0132322 |
| wikiData | Q105034846 |