N-[3-(1,20,21-trihydroxy-10,10-dimethyl-17-methylidene-18-oxo-2,4,6-trioxahexacyclo[9.8.1.116,19.03,12.07,12.013,19]henicosan-5-yl)propyl]acetamide
Internal ID | 943549c3-643b-430f-8ddd-23132eb441d8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | N-[3-(1,20,21-trihydroxy-10,10-dimethyl-17-methylidene-18-oxo-2,4,6-trioxahexacyclo[9.8.1.116,19.03,12.07,12.013,19]henicosan-5-yl)propyl]acetamide |
SMILES (Canonical) | CC(=O)NCCCC1OC2CCC(C3C24C5CCC6C(C5(C(=O)C6=C)C(C3O)(OC4O1)O)O)(C)C |
SMILES (Isomeric) | CC(=O)NCCCC1OC2CCC(C3C24C5CCC6C(C5(C(=O)C6=C)C(C3O)(OC4O1)O)O)(C)C |
InChI | InChI=1S/C26H37NO8/c1-12-14-7-8-15-24-16-9-10-23(3,4)18(24)21(31)26(32,25(15,19(12)29)20(14)30)35-22(24)34-17(33-16)6-5-11-27-13(2)28/h14-18,20-22,30-32H,1,5-11H2,2-4H3,(H,27,28) |
InChI Key | OPMIIISEUNUWGG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H37NO8 |
Molecular Weight | 491.60 g/mol |
Exact Mass | 491.25191714 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.03% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.04% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.14% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.21% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.50% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.31% | 96.77% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.38% | 97.25% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.31% | 97.28% |
CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 88.16% | 90.48% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.00% | 95.38% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.93% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.32% | 91.19% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.72% | 95.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.11% | 91.24% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.00% | 100.00% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.17% | 98.33% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 85.14% | 96.33% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.40% | 96.90% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 84.22% | 98.59% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.49% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.34% | 97.14% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.31% | 93.00% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.58% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.11% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.59% | 94.33% |
CHEMBL5028 | O14672 | ADAM10 | 80.55% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon rubescens |
PubChem | 73010317 |
LOTUS | LTS0072436 |
wikiData | Q105196437 |