3-O-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-2-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxy-6-methoxycarbonyloxan-3-yl] 1-O-methyl propanedioate
Internal ID | 62c96dfb-1e03-4b75-b37c-b48af62c441d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | 3-O-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-2-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxy-6-methoxycarbonyloxan-3-yl] 1-O-methyl propanedioate |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)OC)O)O)OC(=O)CC(=O)OC)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)OC)O)O)OC(=O)CC(=O)OC)O)O |
InChI | InChI=1S/C27H26O15/c1-36-16-5-4-11(6-13(16)28)17-9-15(30)21-14(29)7-12(8-18(21)40-17)39-27-25(41-20(32)10-19(31)37-2)23(34)22(33)24(42-27)26(35)38-3/h4-9,22-25,27-29,33-34H,10H2,1-3H3/t22-,23-,24-,25+,27+/m0/s1 |
InChI Key | SMQZJGPKINBXGZ-HDHXAKMKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H26O15 |
Molecular Weight | 590.50 g/mol |
Exact Mass | 590.12717012 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 2.00 |
There are no found synonyms. |
![2D Structure of 3-O-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-2-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxy-6-methoxycarbonyloxan-3-yl] 1-O-methyl propanedioate 2D Structure of 3-O-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-2-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxy-6-methoxycarbonyloxan-3-yl] 1-O-methyl propanedioate](https://plantaedb.com/storage/docs/compounds/2023/11/2879eb50-869e-11ee-ac68-3bf19bc323b2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.60% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.04% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.62% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.61% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.66% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.48% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.59% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.88% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.33% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.29% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.86% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.41% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.27% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.22% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 86.08% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.67% | 95.89% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.91% | 95.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.85% | 86.92% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.30% | 81.11% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.13% | 97.28% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.94% | 96.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.81% | 90.00% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.59% | 83.10% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.47% | 94.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.99% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Meehania fargesii |
PubChem | 46211759 |
LOTUS | LTS0078901 |
wikiData | Q105256112 |