(1S,2R,5S,6S,7S,9S,10S,14R,15S,19R)-15-[(2R,5S,6R)-5-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-14-methyl-19-[(E)-prop-1-enyl]-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione
| Internal ID | 46a6d777-47ce-42fc-b811-9cec9294b71f |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Prostaglandins and related compounds |
| IUPAC Name | (1S,2R,5S,6S,7S,9S,10S,14R,15S,19R)-15-[(2R,5S,6R)-5-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-14-methyl-19-[(E)-prop-1-enyl]-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione |
| SMILES (Canonical) | CC=CC1CCCC(C(C(=O)C2=CC3C4CC(C(C4C=CC3C2CC(=O)O1)O)OC5C(C(C(C(O5)C)OC)OC)OC)C)OC6CCC(C(O6)C)N(C)C |
| SMILES (Isomeric) | C/C=C/[C@H]1CCC[C@@H]([C@H](C(=O)C2=C[C@H]3[C@@H]4C[C@@H]([C@H]([C@H]4C=C[C@H]3[C@@H]2CC(=O)O1)O)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC)OC)OC)C)O[C@H]6CC[C@@H]([C@H](O6)C)N(C)C |
| InChI | InChI=1S/C42H65NO11/c1-10-12-25-13-11-14-33(53-36-18-17-32(43(5)6)23(3)50-36)22(2)37(45)31-19-28-26(30(31)21-35(44)52-25)15-16-27-29(28)20-34(38(27)46)54-42-41(49-9)40(48-8)39(47-7)24(4)51-42/h10,12,15-16,19,22-30,32-34,36,38-42,46H,11,13-14,17-18,20-21H2,1-9H3/b12-10+/t22-,23-,24+,25+,26-,27+,28-,29-,30+,32+,33+,34+,36+,38+,39+,40-,41-,42+/m1/s1 |
| InChI Key | FVJKAJZISUNYDK-XGTJNXPFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H65NO11 |
| Molecular Weight | 760.00 g/mol |
| Exact Mass | 759.45576189 g/mol |
| Topological Polar Surface Area (TPSA) | 131.00 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.80% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.40% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.36% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.08% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.52% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.87% | 89.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.02% | 83.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.29% | 91.19% |
| CHEMBL3974 | P25116 | Proteinase-activated receptor 1 | 87.29% | 97.78% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.48% | 99.23% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.33% | 97.36% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.09% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.10% | 95.89% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.92% | 97.05% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.14% | 90.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.75% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.38% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162984451 |
| LOTUS | LTS0134619 |
| wikiData | Q105002496 |