3-[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2R,3R,4S,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one
Internal ID | 24f5aa84-036e-4fac-b794-dfad7307a8e7 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3-[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2R,3R,4S,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)C)O)O)OC5C(C(C(OC5O)CO)O)O)C6=CC=C(C=C6)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O[C@@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)O)O)O[C@@H]5[C@H]([C@@H]([C@H](O[C@H]5O)CO)O)O)C6=CC=C(C=C6)O)O)O)O)O |
InChI | InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)32(46-10)48-14-7-15(36)18-16(8-14)49-27(12-3-5-13(35)6-4-12)28(22(18)40)52-33-30(24(42)20(38)11(2)47-33)51-29-25(43)21(39)17(9-34)50-31(29)45/h3-8,10-11,17,19-21,23-26,29-39,41-45H,9H2,1-2H3/t10-,11-,17+,19-,20-,21+,23+,24+,25-,26+,29+,30+,31+,32+,33+/m0/s1 |
InChI Key | CECKUKLQLNTQAZ-HYFUQYQGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O19 |
Molecular Weight | 740.70 g/mol |
Exact Mass | 740.21637904 g/mol |
Topological Polar Surface Area (TPSA) | 304.00 Ų |
XlogP | -1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.74% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.53% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.26% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.83% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.60% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.81% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.57% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.29% | 85.14% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.89% | 95.64% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.85% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.64% | 99.17% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.17% | 93.10% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.96% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.78% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.03% | 95.78% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.36% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.67% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.95% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 82.68% | 90.71% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 81.71% | 98.35% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.15% | 95.83% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.05% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
PubChem | 162997174 |
LOTUS | LTS0073805 |
wikiData | Q104955437 |