(1S,2R,5R,7S,10R,11R,15S,18S,20R,22S)-7-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-(3,4,5-trimethoxybenzoyl)oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid
| Internal ID | 9f8a08e8-8f40-4df8-97bf-018ebc40244b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (1S,2R,5R,7S,10R,11R,15S,18S,20R,22S)-7-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-(3,4,5-trimethoxybenzoyl)oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid |
| SMILES (Canonical) | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C36CC6CC2(CC1OC(=O)C7=CC(=C(C(=C7)OC)OC)OC)C(=O)O)C)(C)C)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(CO9)OC1C(C(C(CO1)O)O)O)O)O)C)C |
| SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]35C[C@H]5C[C@@]6([C@H]4CC([C@H](C6)OC(=O)C7=CC(=C(C(=C7)OC)OC)OC)(C)C)C(=O)O)C)(C)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O)O |
| InChI | InChI=1S/C56H82O21/c1-51(2)20-28-27-10-11-35-53(5)14-13-36(76-49-45(41(62)39(60)32(22-57)73-49)77-48-43(64)40(61)33(24-72-48)74-47-42(63)38(59)29(58)23-71-47)52(3,4)34(53)12-15-54(35,6)56(27)19-26(56)18-55(28,50(66)67)21-37(51)75-46(65)25-16-30(68-7)44(70-9)31(17-25)69-8/h10,16-17,26,28-29,32-43,45,47-49,57-64H,11-15,18-24H2,1-9H3,(H,66,67)/t26-,28+,29-,32-,33-,34+,35-,36+,37+,38+,39-,40+,41+,42-,43-,45-,47+,48+,49+,53+,54-,55-,56-/m1/s1 |
| InChI Key | GCZSPLWJXTWMPZ-VSXLPPPZSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C56H82O21 |
| Molecular Weight | 1091.20 g/mol |
| Exact Mass | 1090.53485962 g/mol |
| Topological Polar Surface Area (TPSA) | 309.00 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 99.12% | 92.98% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.85% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.07% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.22% | 95.17% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.17% | 96.77% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.79% | 96.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.74% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.71% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.48% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.41% | 90.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.01% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.81% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.20% | 92.62% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.72% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.54% | 91.19% |
| CHEMBL5028 | O14672 | ADAM10 | 85.16% | 97.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.99% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.91% | 90.20% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.80% | 89.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.69% | 92.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.23% | 91.07% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.90% | 95.83% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.72% | 97.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.60% | 97.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.53% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.92% | 96.43% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.04% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Verbesina virginica |
| PubChem | 44179783 |
| LOTUS | LTS0069395 |
| wikiData | Q105006596 |