methyl 4-[2-[[5-(1,3-dihydroxypropan-2-yl)-3-[2-[3-ethylidene-5-methoxycarbonyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxy-2-methylcyclopentyl]methoxy]-2-oxoethyl]-5-ethylidene-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate
Internal ID | f69d2b36-e146-44ce-bd31-d8debd87d1ab |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | methyl 4-[2-[[5-(1,3-dihydroxypropan-2-yl)-3-[2-[3-ethylidene-5-methoxycarbonyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxy-2-methylcyclopentyl]methoxy]-2-oxoethyl]-5-ethylidene-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCC3C(C(CC3C(CO)CO)OC(=O)CC4C(=COC(C4=CC)OC5C(C(C(C(O5)CO)O)O)O)C(=O)OC)C |
SMILES (Isomeric) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCC3C(C(CC3C(CO)CO)OC(=O)CC4C(=COC(C4=CC)OC5C(C(C(C(O5)CO)O)O)O)C(=O)OC)C |
InChI | InChI=1S/C44H64O24/c1-6-20-23(26(39(57)59-4)16-62-41(20)67-43-37(55)35(53)33(51)29(13-47)65-43)9-31(49)61-15-25-18(3)28(8-22(25)19(11-45)12-46)64-32(50)10-24-21(7-2)42(63-17-27(24)40(58)60-5)68-44-38(56)36(54)34(52)30(14-48)66-44/h6-7,16-19,22-25,28-30,33-38,41-48,51-56H,8-15H2,1-5H3 |
InChI Key | QGVKUNWDVOEJOC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H64O24 |
Molecular Weight | 977.00 g/mol |
Exact Mass | 976.37875290 g/mol |
Topological Polar Surface Area (TPSA) | 363.00 Ų |
XlogP | -3.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.55% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.80% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.69% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.01% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.99% | 94.73% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.95% | 95.83% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.54% | 86.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.17% | 91.19% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.93% | 97.79% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.85% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 85.66% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.12% | 99.17% |
CHEMBL5028 | O14672 | ADAM10 | 84.91% | 97.50% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.11% | 94.80% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.58% | 94.45% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.22% | 94.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.96% | 89.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.67% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jasminum sambac |
PubChem | 156602789 |
LOTUS | LTS0244244 |
wikiData | Q105220683 |