(7Z,9S,10S,11S,12E,14S,16E,20S,21S,22Z,24Z,26Z)-4,10,14,20-tetrahydroxy-3,7,9,11,17,21,27-heptamethyl-31-[2-[[(7E,9S,10S,11S,12E,14S,16E,20S,21S,22E,24Z,26Z)-4,10,14,20-tetrahydroxy-3,7,9,11,17,21,27-heptamethyl-6,18,28,32,34-pentaoxo-29-azatricyclo[28.3.1.05,33]tetratriaconta-1(33),2,4,7,12,16,22,24,26,30-decaen-31-yl]sulfanyl]ethylamino]-29-azatricyclo[28.3.1.05,33]tetratriaconta-1(33),2,4,7,12,16,22,24,26,30-decaene-6,18,28,32,34-pentone
| Internal ID | 3d689261-85a0-411d-a5b1-40152d34cfd3 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
| IUPAC Name | (7Z,9S,10S,11S,12E,14S,16E,20S,21S,22Z,24Z,26Z)-4,10,14,20-tetrahydroxy-3,7,9,11,17,21,27-heptamethyl-31-[2-[[(7E,9S,10S,11S,12E,14S,16E,20S,21S,22E,24Z,26Z)-4,10,14,20-tetrahydroxy-3,7,9,11,17,21,27-heptamethyl-6,18,28,32,34-pentaoxo-29-azatricyclo[28.3.1.05,33]tetratriaconta-1(33),2,4,7,12,16,22,24,26,30-decaen-31-yl]sulfanyl]ethylamino]-29-azatricyclo[28.3.1.05,33]tetratriaconta-1(33),2,4,7,12,16,22,24,26,30-decaene-6,18,28,32,34-pentone |
| SMILES (Canonical) | CC1C=CC=CC=C(C(=O)NC2=C(C(=O)C3=C(C2=O)C=C(C(=C3C(=O)C(=CC(C(C(C=CC(CC=C(C(=O)CC1O)C)O)C)O)C)C)O)C)NCCSC4=C5C(=O)C6=C(C4=O)C(=C(C(=C6)C)O)C(=O)C(=CC(C(C(C=CC(CC=C(C(=O)CC(C(C=CC=CC=C(C(=O)N5)C)C)O)C)O)C)O)C)C)C |
| SMILES (Isomeric) | C[C@H]1/C=C\C=C/C=C(\C(=O)NC2=C(C(=O)C3=C(C2=O)C=C(C(=C3C(=O)/C(=C\[C@@H]([C@H]([C@H](/C=C/[C@H](C/C=C(/C(=O)C[C@@H]1O)\C)O)C)O)C)/C)O)C)NCCSC4=C5C(=O)C6=C(C4=O)C(=C(C(=C6)C)O)C(=O)/C(=C/[C@@H]([C@H]([C@H](/C=C/[C@H](C/C=C(/C(=O)C[C@@H]([C@H](/C=C/C=C\C=C(/C(=O)N5)\C)C)O)\C)O)C)O)C)/C)/C |
| InChI | InChI=1S/C82H97N3O18S/c1-41-21-17-15-19-23-47(7)81(102)84-68-67(78(100)63-57(76(68)98)37-53(13)74(96)65(63)72(94)51(11)35-49(9)70(92)45(5)27-31-55(86)29-25-43(3)61(90)39-59(41)88)83-33-34-104-80-69-77(99)58-38-54(14)75(97)66(64(58)79(80)101)73(95)52(12)36-50(10)71(93)46(6)28-32-56(87)30-26-44(4)62(91)40-60(89)42(2)22-18-16-20-24-48(8)82(103)85-69/h15-28,31-32,35-38,41-42,45-46,49-50,55-56,59-60,70-71,83,86-89,92-93,96-97H,29-30,33-34,39-40H2,1-14H3,(H,84,102)(H,85,103)/b19-15-,20-16-,21-17-,22-18+,31-27+,32-28+,43-25+,44-26+,47-23-,48-24-,51-35-,52-36+/t41-,42-,45-,46-,49-,50-,55-,56-,59-,60-,70-,71-/m0/s1 |
| InChI Key | VYEVYPKXBMGTHG-OPLFHMNASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C82H97N3O18S |
| Molecular Weight | 1444.70 g/mol |
| Exact Mass | 1443.64878443 g/mol |
| Topological Polar Surface Area (TPSA) | 394.00 Ų |
| XlogP | 12.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.29% | 98.95% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 96.65% | 95.52% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.72% | 90.71% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.63% | 96.21% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.44% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.31% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.13% | 95.56% |
| CHEMBL5145 | P15056 | Serine/threonine-protein kinase B-raf | 90.93% | 97.90% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.24% | 99.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.66% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.98% | 89.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.94% | 93.03% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 88.75% | 96.67% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.58% | 100.00% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 87.45% | 83.14% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 86.91% | 88.84% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.77% | 99.15% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.49% | 89.34% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.35% | 94.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 84.34% | 91.79% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.08% | 90.08% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.96% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.44% | 94.73% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.02% | 96.38% |
| CHEMBL260 | Q16539 | MAP kinase p38 alpha | 82.98% | 97.78% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.96% | 95.93% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.92% | 92.88% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.24% | 96.90% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.09% | 91.24% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.99% | 94.00% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 81.53% | 81.29% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.22% | 96.77% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.64% | 96.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.11% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163192182 |
| LOTUS | LTS0040619 |
| wikiData | Q105298926 |