2,8-Dihydroxy-3,4,7-trimethoxy-9,10-dihydrophenanthrene
| Internal ID | c9d3ab95-6582-42ad-b883-54e094f74cf4 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 2,5,6-trimethoxy-9,10-dihydrophenanthrene-1,7-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H18O5/c1-20-13-7-6-10-11(15(13)19)5-4-9-8-12(18)16(21-2)17(22-3)14(9)10/h6-8,18-19H,4-5H2,1-3H3 |
| InChI Key | OHYOIWRALJDPTD-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 3.00 |
| SCHEMBL23203424 |
| 2,8-dihydroxy-3,4,7-trimethoxy-9,10-dihydrophenanthrene |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.32% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.20% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.47% | 96.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 91.55% | 91.79% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.16% | 98.75% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 91.14% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.74% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.49% | 86.33% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 87.28% | 98.21% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.75% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.23% | 99.17% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 85.62% | 95.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.99% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.66% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.24% | 94.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.20% | 98.11% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 82.40% | 95.12% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.86% | 89.62% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 80.88% | 95.70% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.64% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium nobile |
| PubChem | 24762425 |
| NPASS | NPC10314 |
| ChEMBL | CHEMBL254599 |
| LOTUS | LTS0231324 |
| wikiData | Q105192392 |