[(2S)-4-[(2S)-4-[[(2R,4R,4aR,5S,7R,8S,8aR)-8-[(2S,3aS,5R,6aR)-5-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl]-5-acetyloxy-2-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl]oxy-4-oxobutan-2-yl] (3S)-3-hydroxybutanoate
Internal ID | 5037d15b-96fa-4fc6-96fb-e15230f9adf7 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
IUPAC Name | [(2S)-4-[(2S)-4-[[(2R,4R,4aR,5S,7R,8S,8aR)-8-[(2S,3aS,5R,6aR)-5-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl]-5-acetyloxy-2-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl]oxy-4-oxobutan-2-yl] (3S)-3-hydroxybutanoate |
SMILES (Canonical) | CC1CC(C2(C(C1(C)C3CC4CC(OC4O3)O)CC(CC25CO5)O)COC(=O)CC(C)OC(=O)CC(C)OC(=O)CC(C)O)OC(=O)C |
SMILES (Isomeric) | C[C@@H]1C[C@@H]([C@@]2([C@@H]([C@@]1(C)[C@@H]3C[C@H]4C[C@@H](O[C@H]4O3)O)C[C@H](C[C@]25CO5)O)COC(=O)C[C@H](C)OC(=O)C[C@H](C)OC(=O)C[C@H](C)O)OC(=O)C |
InChI | InChI=1S/C34H52O14/c1-17-7-26(46-21(5)36)34(16-42-27(38)9-19(3)45-29(40)10-20(4)44-28(39)8-18(2)35)24(13-23(37)14-33(34)15-43-33)32(17,6)25-11-22-12-30(41)48-31(22)47-25/h17-20,22-26,30-31,35,37,41H,7-16H2,1-6H3/t17-,18+,19+,20+,22+,23-,24-,25+,26+,30-,31-,32+,33+,34+/m1/s1 |
InChI Key | GWVBTYVATUKCQB-JKTFXSLYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H52O14 |
Molecular Weight | 684.80 g/mol |
Exact Mass | 684.33570633 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of [(2S)-4-[(2S)-4-[[(2R,4R,4aR,5S,7R,8S,8aR)-8-[(2S,3aS,5R,6aR)-5-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl]-5-acetyloxy-2-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl]oxy-4-oxobutan-2-yl] (3S)-3-hydroxybutanoate 2D Structure of [(2S)-4-[(2S)-4-[[(2R,4R,4aR,5S,7R,8S,8aR)-8-[(2S,3aS,5R,6aR)-5-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl]-5-acetyloxy-2-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl]oxy-4-oxobutan-2-yl] (3S)-3-hydroxybutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/27fdf110-86f6-11ee-9015-4bb83cae2965.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.30% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 96.89% | 96.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 95.05% | 97.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.57% | 94.45% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 94.28% | 89.05% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.00% | 85.14% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 91.81% | 82.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.48% | 91.11% |
CHEMBL299 | P17252 | Protein kinase C alpha | 90.44% | 98.03% |
CHEMBL2581 | P07339 | Cathepsin D | 90.19% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.19% | 91.19% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.35% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.33% | 97.09% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.79% | 89.50% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.68% | 82.69% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 87.07% | 85.31% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 86.68% | 97.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.32% | 89.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.75% | 97.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.72% | 97.25% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.59% | 95.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.41% | 86.33% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.74% | 98.75% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.96% | 90.17% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 82.65% | 99.00% |
CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 82.42% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.32% | 100.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.14% | 97.28% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.99% | 96.47% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.46% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scutellaria pontica |
PubChem | 101350402 |
LOTUS | LTS0231323 |
wikiData | Q105022793 |