[2-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl] acetate
| Internal ID | a9fa5467-ec40-41a6-bd32-97b129d85fcb |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | [2-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
| SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)O)OC(=O)C)OC7C(C(C(C(O7)CO)O)O)O)C)C)O |
| SMILES (Isomeric) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)O)OC(=O)C)OC7C(C(C(C(O7)CO)O)O)O)C)C)O |
| InChI | InChI=1S/C43H72O15/c1-20(9-10-27(48)39(5,6)53)29-22(46)16-41(8)26-15-24(56-36-33(52)32(51)31(50)25(17-44)57-36)35-38(3,4)28(11-12-43(35)19-42(26,43)14-13-40(29,41)7)58-37-34(55-21(2)45)30(49)23(47)18-54-37/h20,22-37,44,46-53H,9-19H2,1-8H3 |
| InChI Key | QXBGJYSVZHVPMA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C43H72O15 |
| Molecular Weight | 829.00 g/mol |
| Exact Mass | 828.48712159 g/mol |
| Topological Polar Surface Area (TPSA) | 245.00 Ų |
| XlogP | 2.10 |
| Atomic LogP (AlogP) | 1.13 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 9 |
| Rotatable Bonds | 11 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6078 | 60.78% |
| Caco-2 | - | 0.8817 | 88.17% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.6939 | 69.39% |
| OATP2B1 inhibitior | - | 0.8717 | 87.17% |
| OATP1B1 inhibitior | + | 0.8102 | 81.02% |
| OATP1B3 inhibitior | + | 0.8998 | 89.98% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.6500 | 65.00% |
| BSEP inhibitior | - | 0.4918 | 49.18% |
| P-glycoprotein inhibitior | + | 0.7766 | 77.66% |
| P-glycoprotein substrate | + | 0.6086 | 60.86% |
| CYP3A4 substrate | + | 0.7374 | 73.74% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8804 | 88.04% |
| CYP3A4 inhibition | - | 0.9251 | 92.51% |
| CYP2C9 inhibition | - | 0.7950 | 79.50% |
| CYP2C19 inhibition | - | 0.8502 | 85.02% |
| CYP2D6 inhibition | - | 0.9519 | 95.19% |
| CYP1A2 inhibition | - | 0.8924 | 89.24% |
| CYP2C8 inhibition | + | 0.6669 | 66.69% |
| CYP inhibitory promiscuity | - | 0.9717 | 97.17% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9900 | 99.00% |
| Carcinogenicity (trinary) | Non-required | 0.6989 | 69.89% |
| Eye corrosion | - | 0.9902 | 99.02% |
| Eye irritation | - | 0.9090 | 90.90% |
| Skin irritation | - | 0.6948 | 69.48% |
| Skin corrosion | - | 0.9469 | 94.69% |
| Ames mutagenesis | - | 0.6048 | 60.48% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7171 | 71.71% |
| Micronuclear | - | 0.8000 | 80.00% |
| Hepatotoxicity | - | 0.6815 | 68.15% |
| skin sensitisation | - | 0.9134 | 91.34% |
| Respiratory toxicity | - | 0.5000 | 50.00% |
| Reproductive toxicity | + | 0.7667 | 76.67% |
| Mitochondrial toxicity | - | 0.5500 | 55.00% |
| Nephrotoxicity | - | 0.8981 | 89.81% |
| Acute Oral Toxicity (c) | I | 0.5431 | 54.31% |
| Estrogen receptor binding | + | 0.6878 | 68.78% |
| Androgen receptor binding | + | 0.7379 | 73.79% |
| Thyroid receptor binding | - | 0.5835 | 58.35% |
| Glucocorticoid receptor binding | + | 0.6537 | 65.37% |
| Aromatase binding | + | 0.6710 | 67.10% |
| PPAR gamma | + | 0.7419 | 74.19% |
| Honey bee toxicity | - | 0.5995 | 59.95% |
| Biodegradation | - | 0.7000 | 70.00% |
| Crustacea aquatic toxicity | - | 0.6200 | 62.00% |
| Fish aquatic toxicity | + | 0.8557 | 85.57% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.56% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.64% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.55% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.79% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.21% | 97.09% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 94.16% | 95.69% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 94.09% | 91.24% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.93% | 98.95% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.59% | 95.58% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.48% | 96.47% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 92.35% | 92.88% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.16% | 96.77% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 92.15% | 82.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.82% | 97.79% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 88.68% | 98.75% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 88.09% | 99.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.51% | 97.14% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.33% | 96.61% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 87.27% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.03% | 85.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.70% | 91.07% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.41% | 91.19% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.24% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.11% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.09% | 97.21% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 86.06% | 99.17% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.84% | 92.86% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 85.76% | 95.93% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.70% | 98.10% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.57% | 100.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 85.33% | 94.45% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.28% | 89.50% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.28% | 95.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.25% | 89.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.11% | 94.62% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.64% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.59% | 97.29% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.04% | 94.75% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.05% | 96.21% |
| CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 82.55% | 92.86% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.45% | 89.34% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.18% | 94.08% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.57% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.51% | 86.33% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.47% | 90.24% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.28% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.20% | 95.89% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.12% | 94.33% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.00% | 92.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.92% | 95.89% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.33% | 94.00% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 80.03% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus trimestris |
| PubChem | 163012498 |
| LOTUS | LTS0107507 |
| wikiData | Q105229510 |