(3S,3aS,5aR,5bR,7aR,9S,11aR,11bS,13aR,13bS)-5a,5b,8,8,11a,13b-hexamethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-9-ol
Internal ID | dde2ba2b-6d95-4267-9890-637902db26b5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Hopanoids |
IUPAC Name | (3S,3aS,5aR,5bR,7aR,9S,11aR,11bS,13aR,13bS)-5a,5b,8,8,11a,13b-hexamethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-9-ol |
SMILES (Canonical) | CC(=C)C1CCC2(C1CCC3(C2CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C)C |
SMILES (Isomeric) | CC(=C)[C@H]1CC[C@]2([C@H]1CC[C@@]3([C@@H]2CC[C@@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)C)C |
InChI | InChI=1S/C30H50O/c1-19(2)20-11-15-27(5)21(20)12-17-29(7)23(27)9-10-24-28(6)16-14-25(31)26(3,4)22(28)13-18-30(24,29)8/h20-25,31H,1,9-18H2,2-8H3/t20-,21+,22+,23-,24+,25+,27+,28+,29-,30-/m1/s1 |
InChI Key | LFPVZIIPFONRSW-CQHIDPGZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H50O |
Molecular Weight | 426.70 g/mol |
Exact Mass | 426.386166214 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 9.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.50% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.10% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.73% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.74% | 90.17% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.55% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.36% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.68% | 98.10% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.06% | 97.93% |
CHEMBL2581 | P07339 | Cathepsin D | 83.65% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.40% | 91.11% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.08% | 96.43% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.00% | 92.94% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 82.30% | 95.42% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.98% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.06% | 92.86% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.98% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Celtis laevigata |
PubChem | 162879738 |
LOTUS | LTS0105636 |
wikiData | Q105151118 |