[(1R,2R)-1-[(2S,3R)-2-hydroxy-2-methyl-3-[(Z)-2-methylbut-2-enoyl]oxybutanoyl]oxy-1-(7-methoxy-1,3-benzodioxol-5-yl)propan-2-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate
| Internal ID | 04d4d857-aeef-41a6-b971-1bc19988c08c |
| Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
| IUPAC Name | [(1R,2R)-1-[(2S,3R)-2-hydroxy-2-methyl-3-[(Z)-2-methylbut-2-enoyl]oxybutanoyl]oxy-1-(7-methoxy-1,3-benzodioxol-5-yl)propan-2-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate |
| SMILES (Canonical) | CC=C(C)C(=O)OC(C)C(C)(C(=O)OC(C1=CC2=C(C(=C1)OC)OCO2)C(C)OC(=O)C3(C(O3)C)C)O |
| SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H](C)[C@@](C)(C(=O)O[C@H](C1=CC2=C(C(=C1)OC)OCO2)[C@@H](C)OC(=O)[C@]3([C@H](O3)C)C)O |
| InChI | InChI=1S/C26H34O11/c1-9-13(2)22(27)35-15(4)25(6,30)23(28)36-20(14(3)34-24(29)26(7)16(5)37-26)17-10-18(31-8)21-19(11-17)32-12-33-21/h9-11,14-16,20,30H,12H2,1-8H3/b13-9-/t14-,15-,16-,20+,25+,26-/m1/s1 |
| InChI Key | NBEWQJXZSWAWKR-CNYQZAIBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H34O11 |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.21011190 g/mol |
| Topological Polar Surface Area (TPSA) | 139.00 Ų |
| XlogP | 3.20 |
| Atomic LogP (AlogP) | 2.77 |
| H-Bond Acceptor | 11 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 10 |
| There are no found synonyms. |
![2D Structure of [(1R,2R)-1-[(2S,3R)-2-hydroxy-2-methyl-3-[(Z)-2-methylbut-2-enoyl]oxybutanoyl]oxy-1-(7-methoxy-1,3-benzodioxol-5-yl)propan-2-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/2785be50-83e5-11ee-8d47-510cd698c638.jpg "2D Structure of [(1R,2R)-1-[(2S,3R)-2-hydroxy-2-methyl-3-[(Z)-2-methylbut-2-enoyl]oxybutanoyl]oxy-1-(7-methoxy-1,3-benzodioxol-5-yl)propan-2-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9874 | 98.74% |
| Caco-2 | - | 0.6827 | 68.27% |
| Blood Brain Barrier | + | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.6143 | 61.43% |
| Subcellular localzation | Mitochondria | 0.7105 | 71.05% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8658 | 86.58% |
| OATP1B3 inhibitior | + | 0.9386 | 93.86% |
| MATE1 inhibitior | - | 0.8600 | 86.00% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.8748 | 87.48% |
| P-glycoprotein inhibitior | + | 0.8095 | 80.95% |
| P-glycoprotein substrate | + | 0.5658 | 56.58% |
| CYP3A4 substrate | + | 0.6688 | 66.88% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8683 | 86.83% |
| CYP3A4 inhibition | + | 0.7871 | 78.71% |
| CYP2C9 inhibition | - | 0.5313 | 53.13% |
| CYP2C19 inhibition | + | 0.5445 | 54.45% |
| CYP2D6 inhibition | - | 0.8305 | 83.05% |
| CYP1A2 inhibition | - | 0.6576 | 65.76% |
| CYP2C8 inhibition | + | 0.5300 | 53.00% |
| CYP inhibitory promiscuity | - | 0.5230 | 52.30% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.9343 | 93.43% |
| Carcinogenicity (trinary) | Non-required | 0.4212 | 42.12% |
| Eye corrosion | - | 0.9805 | 98.05% |
| Eye irritation | - | 0.9001 | 90.01% |
| Skin irritation | - | 0.7149 | 71.49% |
| Skin corrosion | - | 0.9397 | 93.97% |
| Ames mutagenesis | + | 0.5146 | 51.46% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6726 | 67.26% |
| Micronuclear | + | 0.7374 | 73.74% |
| Hepatotoxicity | - | 0.5309 | 53.09% |
| skin sensitisation | - | 0.6349 | 63.49% |
| Respiratory toxicity | + | 0.5222 | 52.22% |
| Reproductive toxicity | + | 0.5889 | 58.89% |
| Mitochondrial toxicity | - | 0.5000 | 50.00% |
| Nephrotoxicity | + | 0.5565 | 55.65% |
| Acute Oral Toxicity (c) | III | 0.4270 | 42.70% |
| Estrogen receptor binding | + | 0.7708 | 77.08% |
| Androgen receptor binding | + | 0.6296 | 62.96% |
| Thyroid receptor binding | + | 0.6109 | 61.09% |
| Glucocorticoid receptor binding | + | 0.7846 | 78.46% |
| Aromatase binding | + | 0.6081 | 60.81% |
| PPAR gamma | + | 0.6778 | 67.78% |
| Honey bee toxicity | - | 0.6557 | 65.57% |
| Biodegradation | - | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | + | 0.5600 | 56.00% |
| Fish aquatic toxicity | + | 0.9623 | 96.23% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.46% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.40% | 96.77% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.55% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.41% | 96.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.40% | 97.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.45% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.81% | 97.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.69% | 89.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.54% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.28% | 96.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.94% | 91.07% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.81% | 99.17% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 88.70% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.41% | 95.89% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.18% | 89.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.56% | 91.19% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.43% | 92.62% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.23% | 91.03% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.97% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.20% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.54% | 98.95% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 82.53% | 95.92% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.64% | 94.73% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.15% | 92.88% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.87% | 89.62% |
| PubChem | 163016940 |
| LOTUS | LTS0268536 |
| wikiData | Q105176746 |