2,7,8-trihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one
Internal ID | 452698e7-f2ab-4cd9-980f-33d9494ff57b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 2,7,8-trihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
SMILES (Canonical) | CC1(C(CCC2(C1CC(=O)C3=C2C=CC(=C3O)O)C)O)C |
SMILES (Isomeric) | CC1(C(CCC2(C1CC(=O)C3=C2C=CC(=C3O)O)C)O)C |
InChI | InChI=1S/C17H22O4/c1-16(2)12-8-11(19)14-9(4-5-10(18)15(14)21)17(12,3)7-6-13(16)20/h4-5,12-13,18,20-21H,6-8H2,1-3H3 |
InChI Key | DBXOYSCQKGYZEZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H22O4 |
Molecular Weight | 290.40 g/mol |
Exact Mass | 290.15180918 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 3.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.90% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.03% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.63% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.35% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.07% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.00% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.86% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.30% | 95.89% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.17% | 85.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.81% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.93% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.96% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.63% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.62% | 99.15% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.25% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cotula coronopifolia |
Taiwania cryptomerioides |
PubChem | 162870524 |
LOTUS | LTS0199627 |
wikiData | Q105154398 |