[(1S,2S,3aR,5R,6E,10R,11S,13R,13aR)-1,11,13-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3a-(2-oxopropyl)-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-10-yl] 2-methylpropanoate
| Internal ID | a51be6e1-a3a8-4eee-9baa-13d2b5a12247 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Jatrophane and cyclojatrophane diterpenoids |
| IUPAC Name | [(1S,2S,3aR,5R,6E,10R,11S,13R,13aR)-1,11,13-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3a-(2-oxopropyl)-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-10-yl] 2-methylpropanoate |
| SMILES (Canonical) | CC1CC2(C(C1OC(=O)C)C(C(=C)C(C(C(=O)C(C=CC(C2=O)C)(C)C)OC(=O)C(C)C)OC(=O)C)OC(=O)C)CC(=O)C |
| SMILES (Isomeric) | C[C@H]1C[C@]2([C@H]([C@H]1OC(=O)C)[C@H](C(=C)[C@@H]([C@H](C(=O)C(/C=C/[C@H](C2=O)C)(C)C)OC(=O)C(C)C)OC(=O)C)OC(=O)C)CC(=O)C |
| InChI | InChI=1S/C33H46O11/c1-16(2)31(40)44-28-27(43-23(9)37)20(6)26(42-22(8)36)24-25(41-21(7)35)18(4)14-33(24,15-19(5)34)29(38)17(3)12-13-32(10,11)30(28)39/h12-13,16-18,24-28H,6,14-15H2,1-5,7-11H3/b13-12+/t17-,18+,24-,25+,26+,27+,28-,33-/m1/s1 |
| InChI Key | SLZNZYANPUQEBD-GLPYBOBHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H46O11 |
| Molecular Weight | 618.70 g/mol |
| Exact Mass | 618.30401228 g/mol |
| Topological Polar Surface Area (TPSA) | 156.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.83% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.56% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.95% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.15% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.91% | 94.75% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.90% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.32% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.08% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.03% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.08% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.62% | 90.17% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.25% | 95.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.12% | 91.49% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.41% | 96.47% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.26% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.05% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.42% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.13% | 89.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.44% | 82.69% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.44% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia paralias |
| PubChem | 163195420 |
| LOTUS | LTS0107557 |
| wikiData | Q105255778 |