(2R,3'S,9'R,9'aR)-3',4',9',10-tetrahydroxy-7'-methoxy-7-methylspiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-9,9a-dihydro-3H-benzo[f][1]benzofuran]-5',8',9-trione
| Internal ID | 17a3a7c6-c0b8-43c2-8721-b95665449e2b |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Pyranochromenes |
| IUPAC Name | (2R,3'S,9'R,9'aR)-3',4',9',10-tetrahydroxy-7'-methoxy-7-methylspiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-9,9a-dihydro-3H-benzo[f][1]benzofuran]-5',8',9-trione |
| SMILES (Canonical) | CC1=CC2=CC3=C(C(=C2C(=O)O1)O)OC4(CC3)C(C5=C(C6=C(C(C5O4)O)C(=O)C(=CC6=O)OC)O)O |
| SMILES (Isomeric) | CC1=CC2=CC3=C(C(=C2C(=O)O1)O)O[C@]4(CC3)[C@H](C5=C(C6=C([C@H]([C@@H]5O4)O)C(=O)C(=CC6=O)OC)O)O |
| InChI | InChI=1S/C25H20O11/c1-8-5-10-6-9-3-4-25(35-21(9)19(29)13(10)24(32)34-8)23(31)16-18(28)14-11(26)7-12(33-2)17(27)15(14)20(30)22(16)36-25/h5-7,20,22-23,28-31H,3-4H2,1-2H3/t20-,22-,23+,25+/m1/s1 |
| InChI Key | RWBBKZZLQYYQTA-SRTADBNSSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H20O11 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.10056145 g/mol |
| Topological Polar Surface Area (TPSA) | 169.00 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.40% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.43% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.04% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.95% | 99.23% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.83% | 89.63% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.56% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.04% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.91% | 93.99% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.52% | 85.14% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.20% | 91.49% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.97% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.41% | 95.89% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.34% | 96.67% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.19% | 93.40% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.84% | 96.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.59% | 90.71% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.22% | 91.07% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.05% | 93.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.32% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.24% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.70% | 98.75% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.98% | 94.42% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.42% | 96.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.19% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162845994 |
| LOTUS | LTS0134387 |
| wikiData | Q105246418 |