2,7,14-Trimethyl-16-oxapentacyclo[9.7.0.02,8.05,7.013,17]octadec-10-ene-12,15-dione
| Internal ID | 18d6f3b8-3a58-4d2a-9e45-06c434af6b78 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 2,7,14-trimethyl-16-oxapentacyclo[9.7.0.02,8.05,7.013,17]octadec-10-ene-12,15-dione |
| SMILES (Canonical) | CC1C2C(CC3C(=CCC4C3(CCC5C4(C5)C)C)C2=O)OC1=O |
| SMILES (Isomeric) | CC1C2C(CC3C(=CCC4C3(CCC5C4(C5)C)C)C2=O)OC1=O |
| InChI | InChI=1S/C20H26O3/c1-10-16-14(23-18(10)22)8-13-12(17(16)21)4-5-15-19(13,2)7-6-11-9-20(11,15)3/h4,10-11,13-16H,5-9H2,1-3H3 |
| InChI Key | PIUALDIRBIQPLO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18819469 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
![2D Structure of 2,7,14-Trimethyl-16-oxapentacyclo[9.7.0.02,8.05,7.013,17]octadec-10-ene-12,15-dione](https://plantaedb.com/storage/docs/compounds/2023/11/2714-trimethyl-16-oxapentacyclo97002805701317octadec-10-ene-1215-dione.jpg "2D Structure of 2,7,14-Trimethyl-16-oxapentacyclo[9.7.0.02,8.05,7.013,17]octadec-10-ene-12,15-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.31% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.72% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.24% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.79% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.34% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.40% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.58% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.72% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.72% | 94.45% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.45% | 92.50% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.79% | 94.66% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.50% | 93.04% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.26% | 97.14% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.05% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia retusa |
| Impatiens balsamina |
| PubChem | 74959363 |
| LOTUS | LTS0226410 |
| wikiData | Q105256662 |