2,7-Dihydroxy-4,8-dimethoxy-9,10-dihydrophenanthrene
| Internal ID | 1c1a46cd-0515-4cb1-9956-edfc5116887c |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 1,5-dimethoxy-9,10-dihydrophenanthrene-2,7-diol |
| SMILES (Canonical) | COC1=CC(=CC2=C1C3=C(CC2)C(=C(C=C3)O)OC)O |
| SMILES (Isomeric) | COC1=CC(=CC2=C1C3=C(CC2)C(=C(C=C3)O)OC)O |
| InChI | InChI=1S/C16H16O4/c1-19-14-8-10(17)7-9-3-4-12-11(15(9)14)5-6-13(18)16(12)20-2/h5-8,17-18H,3-4H2,1-2H3 |
| InChI Key | KJDGXFKUTZFDTK-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.02% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.63% | 91.49% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.47% | 98.35% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.60% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.34% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.64% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.52% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.53% | 95.56% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.01% | 91.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.48% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.46% | 98.95% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 87.71% | 91.79% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.28% | 99.15% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.92% | 89.62% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.99% | 82.67% |
| CHEMBL3194 | P02766 | Transthyretin | 81.82% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.67% | 94.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.00% | 95.78% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 80.74% | 98.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eulophia nuda |
| PubChem | 155919943 |
| LOTUS | LTS0073452 |
| wikiData | Q105141790 |