2,7-Dihydroxy-4-isopropyl-6-methylnaphthalene-1-carbaldehyde
Internal ID | 383b8021-6b2e-495b-a9b2-0706f3001168 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 2,7-dihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde |
SMILES (Canonical) | CC1=CC2=C(C=C1O)C(=C(C=C2C(C)C)O)C=O |
SMILES (Isomeric) | CC1=CC2=C(C=C1O)C(=C(C=C2C(C)C)O)C=O |
InChI | InChI=1S/C15H16O3/c1-8(2)10-5-15(18)13(7-16)12-6-14(17)9(3)4-11(10)12/h4-8,17-18H,1-3H3 |
InChI Key | GBYIRCXHWOBGHE-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H16O3 |
Molecular Weight | 244.28 g/mol |
Exact Mass | 244.109944368 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 4.00 |
2,7-Dihydroxy-4-isopropyl-6-methylnaphthalene-1-carbaldehyde |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 97.40% | 98.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.11% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.34% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.08% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.03% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.20% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.14% | 93.40% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.94% | 89.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.31% | 90.71% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.17% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alangium chinense |
PubChem | 71726175 |
NPASS | NPC41847 |
ChEMBL | CHEMBL2386315 |
LOTUS | LTS0001895 |
wikiData | Q105006144 |