[(1R,3S,5R,7S,9R,11S,13R,14R,16S,18R,20S,22R,25S,27S,30S,31R,33R,34S,35R,37R,40S,42R,44S,46S,48R)-40-[(2S,3Z)-2,6-dihydroxy-5-methylideneocta-3,7-dien-2-yl]-34-hydroxy-13,25,27,30,35-pentamethyl-39-methylidene-13-(2-sulfooxyethyl)-4,8,12,17,21,26,32,36,41,45,49-undecaoxaundecacyclo[25.22.0.03,25.05,22.07,20.09,18.011,16.031,48.033,46.035,44.037,42]nonatetracontan-14-yl] hydrogen sulfate
| Internal ID | b5242ec4-bcb0-40c6-830a-ce979a8ea91b |
| Taxonomy | Phenylpropanoids and polyketides > Ciguatera toxins |
| IUPAC Name | [(1R,3S,5R,7S,9R,11S,13R,14R,16S,18R,20S,22R,25S,27S,30S,31R,33R,34S,35R,37R,40S,42R,44S,46S,48R)-40-[(2S,3Z)-2,6-dihydroxy-5-methylideneocta-3,7-dien-2-yl]-34-hydroxy-13,25,27,30,35-pentamethyl-39-methylidene-13-(2-sulfooxyethyl)-4,8,12,17,21,26,32,36,41,45,49-undecaoxaundecacyclo[25.22.0.03,25.05,22.07,20.09,18.011,16.031,48.033,46.035,44.037,42]nonatetracontan-14-yl] hydrogen sulfate |
| SMILES (Canonical) | CC1CCC2(C(CC3C(O2)(CCC4C(O3)CC5C(O4)CC6C(O5)CC7C(O6)CC(C(O7)(C)CCOS(=O)(=O)O)OS(=O)(=O)O)C)OC8C1OC9C(C8)OC1CC2C(CC(=C)C(O2)C(C)(C=CC(=C)C(C=C)O)O)OC1(C9O)C)C |
| SMILES (Isomeric) | C[C@H]1CC[C@]2([C@@H](C[C@H]3[C@@](O2)(CC[C@@H]4[C@H](O3)C[C@H]5[C@@H](O4)C[C@@H]6[C@H](O5)C[C@H]7[C@@H](O6)C[C@H]([C@@](O7)(C)CCOS(=O)(=O)O)OS(=O)(=O)O)C)O[C@H]8[C@@H]1O[C@H]9[C@H](C8)O[C@H]1C[C@@H]2[C@@H](CC(=C)[C@H](O2)[C@](C)(/C=C\C(=C)C(C=C)O)O)O[C@@]1([C@H]9O)C)C |
| InChI | InChI=1S/C55H82O22S2/c1-10-30(56)27(2)11-14-51(5,58)50-29(4)19-39-38(72-50)25-46-55(9,75-39)49(57)48-42(71-46)23-41-47(73-48)28(3)12-15-53(7)44(70-41)26-43-54(8,77-53)16-13-31-32(69-43)20-34-33(66-31)21-35-36(67-34)22-40-37(68-35)24-45(76-79(62,63)64)52(6,74-40)17-18-65-78(59,60)61/h10-11,14,28,30-50,56-58H,1-2,4,12-13,15-26H2,3,5-9H3,(H,59,60,61)(H,62,63,64)/b14-11-/t28-,30?,31+,32+,33-,34-,35+,36+,37-,38+,39+,40-,41+,42-,43-,44+,45+,46-,47+,48-,49-,50-,51-,52+,53-,54-,55-/m0/s1 |
| InChI Key | CWRLIVGLMMHNBD-HUYSUFTRSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C55H82O22S2 |
| Molecular Weight | 1159.40 g/mol |
| Exact Mass | 1158.47391659 g/mol |
| Topological Polar Surface Area (TPSA) | 306.00 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.75% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.51% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.88% | 96.38% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.58% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.36% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.22% | 91.11% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 93.07% | 91.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.15% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.32% | 86.33% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.90% | 96.61% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 89.88% | 92.88% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.84% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.68% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.26% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.25% | 95.89% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 89.02% | 85.31% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.67% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.39% | 94.45% |
| CHEMBL233 | P35372 | Mu opioid receptor | 87.61% | 97.93% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.50% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.41% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.75% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.71% | 95.93% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.65% | 91.07% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.83% | 94.73% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.71% | 93.04% |
| CHEMBL238 | Q01959 | Dopamine transporter | 84.46% | 95.88% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.12% | 96.90% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.51% | 98.05% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.88% | 95.50% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.28% | 97.50% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.75% | 95.71% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.24% | 96.25% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.16% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101198549 |
| LOTUS | LTS0103226 |
| wikiData | Q104971475 |