4-[7-(beta-D-Glucopyranuronosyloxy)-5-hydroxy-4-oxo-4H-1-benzopyran-2-yl]-2-methoxyphenyl beta-D-glucopyranosiduronic acid
Internal ID | d1ff74d3-0f70-43a4-b5ae-db0d9fb43a33 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-[7-[(2S,3R,4S,5S,6S)-6-carboxy-3,4,5-trihydroxyoxan-2-yl]oxy-5-hydroxy-4-oxochromen-2-yl]-2-methoxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O)OC5C(C(C(C(O5)C(=O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C(=O)O)O)O)O |
InChI | InChI=1S/C28H28O18/c1-41-14-4-8(2-3-12(14)44-28-22(36)18(32)20(34)24(46-28)26(39)40)13-7-11(30)16-10(29)5-9(6-15(16)43-13)42-27-21(35)17(31)19(33)23(45-27)25(37)38/h2-7,17-24,27-29,31-36H,1H3,(H,37,38)(H,39,40)/t17-,18-,19-,20-,21+,22+,23-,24-,27+,28+/m0/s1 |
InChI Key | XGVYZZQNJZYTNO-MUZNOBILSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H28O18 |
Molecular Weight | 652.50 g/mol |
Exact Mass | 652.12756404 g/mol |
Topological Polar Surface Area (TPSA) | 289.00 Ų |
XlogP | -0.50 |
4-[7-(beta-D-Glucopyranuronosyloxy)-5-hydroxy-4-oxo-4H-1-benzopyran-2-yl]-2-methoxyphenyl beta-D-glucopyranosiduronic acid |
80366-06-9 |
![2D Structure of 4-[7-(beta-D-Glucopyranuronosyloxy)-5-hydroxy-4-oxo-4H-1-benzopyran-2-yl]-2-methoxyphenyl beta-D-glucopyranosiduronic acid 2D Structure of 4-[7-(beta-D-Glucopyranuronosyloxy)-5-hydroxy-4-oxo-4H-1-benzopyran-2-yl]-2-methoxyphenyl beta-D-glucopyranosiduronic acid](https://plantaedb.com/storage/docs/compounds/2023/11/26bbbf30-8573-11ee-ad32-0d188f948545.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.23% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.29% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 95.37% | 90.71% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.21% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.47% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.45% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.97% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.10% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.91% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.78% | 99.15% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.47% | 95.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.43% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.59% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.17% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.52% | 95.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.84% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.61% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.00% | 86.92% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.97% | 99.23% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.63% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.89% | 94.73% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.82% | 97.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.52% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Medicago sativa |
PubChem | 163000074 |
LOTUS | LTS0197473 |
wikiData | Q105327874 |